CAS 5444-61-1

1-benzyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

Description:

1-Benzyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features a benzyl group attached to the nitrogen of the pyrazole ring, contributing to its unique chemical properties. It typically exhibits moderate solubility in organic solvents and may have limited solubility in water, depending on the specific conditions. The presence of the amine functional group suggests potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry due to its potential biological activities, including anti-inflammatory or anticancer properties, although specific biological data would need to be referenced for detailed applications. Its molecular structure allows for various synthetic modifications, making it a versatile building block in drug development. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₁N₅

InChI: InChI=1/C12H11N5/c13-11-10-6-16-17(12(10)15-8-14-11)7-9-4-2-1-3-5-9/h1-6,8H,7H2,(H2,13,14,15)

SMILES: c1ccc(cc1)Cn1c2c(cn1)c(N)ncn2

Synonyms:

• 1H-pyrazolo[3,4-d]pyrimidin-4-amine, 1-(phenylmethyl)-

1-Benzyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

CAS: 5444-61-1

Formula: C₁₂H₁₁N₅

Purity: 96%

Color and Shape: Solid

Molecular weight: 225.2492

Ref: IN-DA00E0Z4

1-Benzyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

CAS: 5444-61-1

1-Benzyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

Purity: 96%

Molecular weight: 225.25g/mol

Ref: 54-OR92754

1-BENZYL-1H-PYRAZOLO[3,4-D]PYRIMIDIN-4-AMINE

CAS: 5444-61-1

Purity: 95.0%

Molecular weight: 225.2550048828125

Ref: 10-F501769