CymitQuimica logo

CAS 54442-28-3

:

ethyl 4-methyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate

Description:
Ethyl 4-methyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate, with the CAS number 54442-28-3, is a chemical compound characterized by its unique bicyclic structure that incorporates both a benzene ring and a heterocyclic oxazine moiety. This compound typically exhibits properties associated with both esters and heterocycles, including moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The ethyl ester group contributes to its volatility and potential for undergoing hydrolysis in the presence of water or acids. Additionally, the presence of the methyl group on the benzoxazine ring can influence its electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. This compound may find applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex chemical entities. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C12H15NO3
InChI:InChI=1/C12H15NO3/c1-3-15-12(14)11-8-13(2)9-6-4-5-7-10(9)16-11/h4-7,11H,3,8H2,1-2H3
SMILES:CCOC(=O)C1CN(C)c2ccccc2O1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.