CAS 544423-20-3: 3-chloro-N-(2,6-diethylphenyl)propanamide
Description:3-Chloro-N-(2,6-diethylphenyl)propanamide is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a chlorine atom at the third position of the propanamide structure contributes to its reactivity and potential biological activity. The compound features a diethyl-substituted phenyl group, which enhances its lipophilicity and may influence its interaction with biological targets. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic characteristics. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the chlorine and diethyl groups may play a role in modulating biological activity. Additionally, the compound's stability and reactivity can be influenced by the presence of the chlorine atom, which may participate in nucleophilic substitution reactions. Overall, 3-chloro-N-(2,6-diethylphenyl)propanamide is a compound of interest for further research in various chemical and biological contexts.
Formula:C13H18ClNO
InChI:InChI=1/C13H18ClNO/c1-3-10-6-5-7-11(4-2)13(10)15-12(16)8-9-14/h5-7H,3-4,8-9H2,1-2H3,(H,15,16)
- Synonyms:
- propanamide, 3-chloro-N-(2,6-diethylphenyl)-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3-chloro-N-(2,6-diethylphenyl)propanamide REF: IN-DA00DAUBCAS: 544423-20-3 | - - - | To inquire | Tue 29 Apr 25 |
 | 3-Chloro-N-(2,6-diethylphenyl)propanamide REF: 3D-FC115101CAS: 544423-20-3 | Min. 95% | - - - | Discontinued product |
3-Chloro-N-(2,6-diethylphenyl)propanamide
Ref: 3D-FC115101
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
