CymitQuimica logo

CAS 544451-69-6

:

6-(butylcarbamoyl)cyclohex-3-ene-1-carboxylic acid

Description:
6-(Butylcarbamoyl)cyclohex-3-ene-1-carboxylic acid is an organic compound characterized by its cyclohexene structure, which features a carboxylic acid functional group and a butylcarbamoyl substituent. This compound typically exhibits properties associated with both cyclic and aliphatic structures, including moderate solubility in polar solvents due to the presence of the carboxylic acid group. The butylcarbamoyl moiety contributes to its potential as a ligand in coordination chemistry or as a building block in organic synthesis. The presence of the double bond in the cyclohexene ring may impart reactivity, making it susceptible to electrophilic addition reactions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Its molecular structure suggests potential for hydrogen bonding, influencing its physical properties such as melting point and boiling point. Overall, 6-(butylcarbamoyl)cyclohex-3-ene-1-carboxylic acid is a versatile compound with applications in various fields, including medicinal chemistry and materials science.
Formula:C12H19NO3
InChI:InChI=1/C12H19NO3/c1-2-3-8-13-11(14)9-6-4-5-7-10(9)12(15)16/h4-5,9-10H,2-3,6-8H2,1H3,(H,13,14)(H,15,16)
SMILES:CCCCN=C(C1CC=CCC1C(=O)O)O
Found 1 products.