CAS 544467-07-4

4-[3-(azidomethyl)phenyl]-2,4-dioxobutanoic acid

Description:

4-[3-(Azidomethyl)phenyl]-2,4-dioxobutanoic acid is a chemical compound characterized by its unique structure, which includes an azidomethyl group attached to a phenyl ring and a dioxobutanoic acid moiety. This compound features both acidic and potentially reactive functional groups, making it of interest in various chemical applications, including medicinal chemistry and materials science. The presence of the azide group suggests potential for click chemistry reactions, which can be utilized for bioconjugation or polymer synthesis. The dioxobutanoic acid component indicates that the compound may exhibit keto-enol tautomerism, influencing its reactivity and stability. Additionally, the compound's molecular structure may impart specific solubility and polarity characteristics, affecting its behavior in different solvents. Overall, 4-[3-(azidomethyl)phenyl]-2,4-dioxobutanoic acid is a versatile compound with potential applications in synthetic organic chemistry and drug development, although its specific properties would need to be evaluated through experimental studies.

Formula: C₁₁H₉N₃O₄

InChI: InChI=1/C11H9N3O4/c12-14-13-6-7-2-1-3-8(4-7)9(15)5-10(16)11(17)18/h1-4H,5-6H2,(H,17,18)

SMILES: c1cc(cc(c1)C(=O)CC(=O)C(=O)O)CN=[N+]=[NH-]

HIV-1 integrase inhibitor

CAS: 544467-07-4

HIV-1 Integrase Inhibitor is an antiretroviral compound with a mode of action that blocks the viral enzyme integrase, preventing the integration of viral DNA into the host genome. It is used for the treatment of HIV infection.

Formula: C₁₁H₉N₃O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 247.21 g/mol

Ref: 3D-FA64909

HIV-1 integrase inhibitor

CAS: 544467-07-4

Hiv-1 integrase inhibitor is an effective anti-HIV drug.

Formula: C₁₁H₉N₃O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 247.21

Ref: TM-T11566