CAS 54449-30-8
:pyrrolo[1,2-a][1,3,5]triazine-2,4(1H,3H)-dione
Description:
Pyrrolo[1,2-a][1,3,5]triazine-2,4(1H,3H)-dione, identified by its CAS number 54449-30-8, is a heterocyclic organic compound characterized by a fused ring system that includes both a pyrrole and a triazine moiety. This compound typically exhibits a planar structure, which contributes to its potential for π-π stacking interactions, making it of interest in materials science and organic electronics. The presence of the dione functional groups indicates that it can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Its unique structure may also impart interesting electronic properties, making it a candidate for applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, the compound may exhibit biological activity, although specific biological properties would require further investigation. Overall, pyrrolo[1,2-a][1,3,5]triazine-2,4(1H,3H)-dione represents a versatile scaffold in organic chemistry with potential utility in various fields.
Formula:C6H5N3O2
InChI:InChI=1/C6H5N3O2/c10-5-7-4-2-1-3-9(4)6(11)8-5/h1-3H,(H2,7,8,10,11)
SMILES:c1cc2[nH]c(nc(=O)n2c1)O
Synonyms:- Pyrrolo[1,2-a]-1,3,5-triazine-2,4(1H,3H)-dione
- Pyrrolo[1,2-a][1,3,5]triazine-2,4(1H,3H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
