
CAS 5445-45-4
:2-[(2-ethyl-6-methylphenyl)amino]-2-oxoethyl 3-hydroxynaphthalene-2-carboxylate
Description:
The chemical substance known as 2-[(2-ethyl-6-methylphenyl)amino]-2-oxoethyl 3-hydroxynaphthalene-2-carboxylate, with the CAS number 5445-45-4, is a complex organic compound characterized by its unique structure that includes a naphthalene moiety, an amino group, and an ester functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, which may be attributed to its aromatic and functional groups. The presence of the hydroxyl group suggests it may engage in hydrogen bonding, influencing its reactivity and interactions in biological systems. Additionally, the compound may display specific optical properties due to its conjugated system, making it of interest in fields such as pharmaceuticals or materials science. Its synthesis and applications could be explored further in research contexts, particularly in relation to its potential therapeutic effects or as a building block in organic synthesis.
Formula:C22H21NO4
InChI:InChI=1/C22H21NO4/c1-3-15-10-6-7-14(2)21(15)23-20(25)13-27-22(26)18-11-16-8-4-5-9-17(16)12-19(18)24/h4-12,24H,3,13H2,1-2H3,(H,23,25)
SMILES:CCc1cccc(C)c1N=C(COC(=O)c1cc2ccccc2cc1O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2,3-Dihydro-1H-inden-2-yl)methanol
CAS:Formula:C10H12OPurity:95%Color and Shape:SolidMolecular weight:148.2017(2,3-Dihydro-1H-inden-2-yl)methanol
CAS:(2,3-Dihydro-1H-inden-2-yl)methanolPurity:96%Molecular weight:148.20g/mol(2,3-Dihydro-1H-inden-2-yl)methanol
CAS:(2,3-Dihydro-1H-inden-2-yl)methanol is an organometallic compound that has the chemical formula CH(CH)CHO. It is classified as an aromatic alcohol based on its substituent. (2,3-Dihydro-1H-inden-2-yl)methanol has a linear structure with a hydrogen atom at the end of each carbon chain and two carbonyl groups. The equilibrium between this compound and its isomers can be determined by calculating the difference in energy between each form. The properties of this compound depend on the solvent it is mixed with, as well as its solvents’ polarity. This compound can be used for perfuming or for cyclohexanol production.Formula:C10H12OPurity:Min. 95%Molecular weight:148.2 g/mol



