CAS 54451-25-1
:Cerium (III) carbonate hydrate
Description:
Cerium (III) carbonate hydrate, with the CAS number 54451-25-1, is an inorganic compound that consists of cerium in the +3 oxidation state, carbonate ions, and water molecules. It typically appears as a white to off-white solid and is known for its relatively low solubility in water, which can vary depending on the degree of hydration. This compound is often used in various applications, including as a precursor in the synthesis of cerium-based materials and catalysts, as well as in research related to rare earth elements. Cerium (III) carbonate hydrate exhibits properties typical of lanthanide compounds, such as paramagnetism and the ability to form complexes with various ligands. Its thermal stability allows it to decompose upon heating, releasing carbon dioxide and water. Handling this compound requires standard safety precautions, as with other rare earth compounds, due to potential health risks associated with inhalation or ingestion. Overall, cerium (III) carbonate hydrate is significant in both industrial and academic settings due to its unique chemical properties and applications.
Formula:CH2CeO4
InChI:InChI=1/CH2O3.Ce.H2O/c2-1(3)4;;/h(H2,2,3,4);;1H2/q;+3;/p-2
Synonyms:- CeriumcarbonatehydrateREOwhitextl
- Cerium(+3) Cation Carbonate Hydrate
- Cerium carbonate hydrate
- Cerous Caibonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Cerium(III) carbonate hydrate, REacton™, 99.999% (REO)
CAS:Cerium(III) carbonate hydrate is used to prepare cerium chloride and incandescent lamps. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product /Formula:C3Ce2O9Purity:99.999%Molecular weight:460.26Cerium(III) carbonate hydrate, REacton™, 99.9% (REO)
CAS:Raw material of various high purity cerium complexes and high grad polishing powder. Cerium Carbonate is used to decolorize glass by keeping iron in its ferrous state. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and labeFormula:C3Ce2O9Purity:99.9%Molecular weight:460.26Cerium(III) carbonate hydrate (99+%-Ce) (REO)
CAS:Cerium(III) carbonate hydrate (99+%-Ce) (REO)
Formula:Ce2(CO3)3·XH2OPurity:(99+%-Ce)Color and Shape:white xtl.Molecular weight:460.29Cerium(III) carbonate hydrate (96%-Ce) (REO)
CAS:Cerium(III) carbonate hydrate (96%-Ce) (REO)
Formula:Ce2(CO3)3·XH2OPurity:(96%-Ce)Color and Shape:off-white pwdr.Molecular weight:460.29Cerium(III) carbonate hydrate
CAS:Cerium(III) carbonate hydratePurity:99.9%Color and Shape:White PowderMolecular weight:478.27g/molCerium (III) carbonate hydrate
CAS:Cerium (III) carbonate hydratePurity:99.99%Molecular weight:478.279g/mol



