CAS 54460-46-7
:Cycloprate
Description:
Cycloprate, with the CAS number 54460-46-7, is a chemical compound that belongs to the class of cyclic compounds. It is characterized by its unique cyclic structure, which can influence its reactivity and interactions with other substances. Cycloprate is typically used in various applications, including as an intermediate in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. The compound may exhibit specific physical properties such as a distinct boiling point, melting point, and solubility characteristics, which are essential for its practical applications. Additionally, its chemical behavior can be influenced by functional groups present in its structure, affecting its stability and reactivity under different conditions. Safety data sheets and regulatory information should be consulted for handling and usage guidelines, as with any chemical substance. Overall, Cycloprate's unique structural features contribute to its utility in various chemical processes and applications.
Formula:C20H38O2
InChI:InChI=1S/C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-22-20(21)19-16-17-19/h19H,2-18H2,1H3
InChI key:InChIKey=NSCKKHGFMYTPBG-UHFFFAOYSA-N
SMILES:C(OCCCCCCCCCCCCCCCC)(=O)C1CC1
Synonyms:- 54460-46-7
- Cycloprate
- Cyclopropanecarboxylic acid, hexadecyl ester
- Cyclopropate
- Zardex
- Zr 856
- Hexadecyl cyclopropanecarboxylate
- Hexadecyl cyclopropanecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cycloprate
CAS:Controlled ProductApplications Cycloprate is an insecticide with ovicidal activity.
References Asano, S., et al.: Apl. Entomol. Zool., 17, 67 (1982); Asano, S., et al.: Nippon Oyo Dobutsu Konchu Gakkaishi, 23, 113 (1979)Formula:C20H38O2Color and Shape:Colourless To Off-WhiteMolecular weight:310.51
