CAS 54464-18-5

4-[(2-Ethoxybenzoyl)amino]butanoic acid

Description:

4-[(2-Ethoxybenzoyl)amino]butanoic acid, with the CAS number 54464-18-5, is an organic compound characterized by its amine and carboxylic acid functional groups. This substance features a butanoic acid backbone, which contributes to its acidic properties, while the presence of the 2-ethoxybenzoyl moiety enhances its potential for various chemical interactions. The ethoxy group provides hydrophobic characteristics, potentially influencing its solubility and reactivity in organic solvents. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drug candidates. Its structural features suggest that it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in biological systems. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 4-[(2-Ethoxybenzoyl)amino]butanoic acid represents a versatile chemical entity with potential applications in medicinal chemistry and related fields.

Formula: C₁₃H₁₇NO₄

InChI: InChI=1S/C13H17NO4/c1-2-18-11-7-4-3-6-10(11)13(17)14-9-5-8-12(15)16/h3-4,6-7H,2,5,8-9H2,1H3,(H,14,17)(H,15,16)

InChI key: InChIKey=DGIWGBMOVKEMLQ-UHFFFAOYSA-N

SMILES: C(NCCCC(O)=O)(=O)C1=C(OCC)C=CC=C1

Synonyms:

• 4-[(2-Ethoxybenzoyl)amino]butanoic acid
• Butanoic acid, 4-[(2-ethoxybenzoyl)amino]-

4-[(2-Ethoxybenzoyl)amino]butanoic acid

CAS: 54464-18-5

4-[(2-Ethoxybenzoyl)amino]butanoic acid is a natural product that belongs to the class of phytochemicals. It is an analytical standard used for HPLC and has been isolated from plants such as the leaves of "Rhododendron ponticum" and the bark of "Quercus ilex". 4-[(2-Ethoxybenzoyl)amino]butanoic acid has been shown to have anti-inflammatory properties, which may be due to its ability to inhibit prostaglandin synthesis.

Formula: C₁₃H₁₇NO₄

Purity: Min. 95%

Molecular weight: 251.28 g/mol

Ref: 3D-ECA46418