CAS 544686-14-8
:4-chloro-2,3,5,6-tetradeuterio-benzenesulfonamide
Description:
4-Chloro-2,3,5,6-tetradeuterio-benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group attached to a chlorinated benzene ring. The presence of deuterium, a stable isotope of hydrogen, indicates that this compound is a labeled version, often used in research and analytical chemistry to trace reactions or study metabolic pathways. The chlorination at the para position of the benzene ring contributes to its reactivity and potential applications in pharmaceuticals or agrochemicals. The sulfonamide group is known for its antibacterial properties, making this compound of interest in medicinal chemistry. Its molecular structure suggests it may exhibit unique physical and chemical properties, such as solubility and stability, influenced by the presence of both chlorine and deuterium. Additionally, the compound's CAS number, 544686-14-8, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, this compound exemplifies the intersection of organic chemistry and isotopic labeling, providing valuable insights in various scientific fields.
Formula:C6H2D2ClNO2S
InChI:InChI=1/C6H6ClNO2S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,(H2,8,9,10)/i1D,2D,3D,4D
SMILES:c1(c(c(c(c(c1Cl)[2H])[2H])S(=O)(=O)N)[2H])[2H]
Synonyms:- NSC 403674-d4
- 4-Chlorophenylsulfonamide-d4
- p-Chlorobenzenesulfonamide-d4
- ADD 55051-d4
- p-Chlorophenylsulfonamide-d4
- 4-Chlorobenzene-d4-sulfonamide
- NSC 9913-d4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chlorobenzene-d4-sulfonamide
CAS:Controlled Product<p>Applications Anticonvulsant against audiogenic convulsion.<br>References Goeres, E., et al.: Acta Biol. Med. Ger., 23, 679 (1969)<br></p>Formula:C62H4H2ClNO2SColor and Shape:NeatMolecular weight:195.66
