CAS 5448-43-1

6-Chloroquinoxaline

Description:

6-Chloroquinoxaline is a heterocyclic compound characterized by a fused bicyclic structure containing both a benzene and a pyrazine ring. Its molecular formula is C8H6ClN3, indicating the presence of chlorine, carbon, hydrogen, and nitrogen atoms. This compound typically appears as a yellow to light brown solid and is known for its role in various chemical and biological applications, including its potential as a pharmacological agent. 6-Chloroquinoxaline exhibits moderate solubility in organic solvents, such as ethanol and dimethyl sulfoxide, but is less soluble in water. The presence of the chlorine atom at the 6-position of the quinoxaline ring influences its reactivity and biological activity, making it a subject of interest in medicinal chemistry. Additionally, it can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which are valuable in synthetic organic chemistry. Overall, 6-Chloroquinoxaline serves as a versatile building block in the development of new compounds with potential therapeutic applications.

Formula: C₈H₅ClN₂

InChI: InChI=1/C8H5ClN2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-5H

SMILES: c1cc2c(cc1Cl)nccn2

Synonyms:

• Quinoxaline, 6-chloro-

6-Chloroquinoxaline

CAS: 5448-43-1

Formula: C₈H₅ClN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 164.5917

Ref: IN-DA00D8BN

6-Chloroquinoxaline

CAS: 5448-43-1

6-Chloroquinoxaline

Formula: C₈H₅ClN₂

Purity: ≥95%

Color and Shape: brown solid

Molecular weight: 164.59g/mol

Ref: 54-OR11146

7-Chloroquinoxaline

CAS: 5448-43-1

7-Chloroquinoxaline is a nucleophilic compound that can be synthesized by reductive chlorination of 7-chloroquinoline. 7-Chloroquinoxaline has been shown to have anticancer activity in vitro, as well as the ability to inhibit the proliferation of human breast cancer cells (MCF-7) in culture. It also inhibits glyoxalase I and II, which are enzymes that catalyze the conversion of glyoxal to D-lactate and H2O2. This inhibition may be due to its ability to react with the C=N bond at carbon 2 of dimethylformamide (DMF), forming a covalent adduct with DMF and an anticancer agent such as methotrexate or 5-fluorouracil. The formation of this conjugate would result in a decrease in DMF concentration, leading to decreased production of H2O2 and increased levels of D-l

Formula: C₈H₅ClN₂

Purity: Min. 95%

Molecular weight: 164.59 g/mol

Ref: 3D-FC66699

6-Chloroquinoxaline

CAS: 5448-43-1

Formula: C₈H₅ClN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 164.59

Ref: 10-F241868