CAS 5448-52-2
:7-chloro-4-ethoxy-quinoline
Description:
7-Chloro-4-ethoxyquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 7-position and an ethoxy group at the 4-position contributes to its unique chemical properties. This compound typically appears as a solid or crystalline substance and is known for its potential biological activity, including antimicrobial and antitumor properties. Its molecular structure allows for various interactions, making it of interest in medicinal chemistry and drug development. The compound is soluble in organic solvents, and its reactivity can be influenced by the substituents on the quinoline ring. Additionally, 7-chloro-4-ethoxyquinoline may undergo various chemical reactions, such as electrophilic substitutions or nucleophilic attacks, depending on the conditions and reagents used. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or environmental impact.
Formula:C11H10ClNO
InChI:InChI=1/C11H10ClNO/c1-2-14-11-5-6-13-10-7-8(12)3-4-9(10)11/h3-7H,2H2,1H3
Synonyms:- 7-chloro-4-ethoxy-quinoline
- Quinoline, 7-chloro-4-ethoxy-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
