CAS 54494-12-1

4-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline

Description:

4-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline, with the CAS number 54494-12-1, is an organic compound characterized by its unique structure that includes an aniline moiety and a phenyl-substituted oxadiazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential fluorescence, making it of interest in various applications, including materials science and organic electronics. The presence of the oxadiazole ring contributes to its electronic properties, which can be advantageous in the development of light-emitting devices or sensors. Additionally, the compound may exhibit biological activity, which could be explored for pharmaceutical applications. Its synthesis generally involves the coupling of an appropriate aniline derivative with a phenyl-oxadiazole precursor. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact. Overall, 4-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline represents a versatile structure with promising characteristics for research and industrial applications.

Formula: C₁₄H₁₁N₃O

InChI: InChI=1/C14H11N3O/c15-12-8-6-11(7-9-12)14-16-13(17-18-14)10-4-2-1-3-5-10/h1-9H,15H2

SMILES: c1ccc(cc1)c1nc(c2ccc(cc2)N)on1

Synonyms:

• Benzenamine, 4-(3-Phenyl-1,2,4-Oxadiazol-5-Yl)-
• 4-(3-Phenyl-1,2,4-oxadiazol-5-yl)aniline

4-(3-phenyl-1,2,4-oxadiazol-5-yl)aniline

CAS: 54494-12-1

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 237.26199340820312

Ref: 10-F315762