CAS 545-47-1: Lupeol
Description:Lupeol, with the CAS number 545-47-1, is a triterpenoid compound primarily found in various plants, including fruits, vegetables, and medicinal herbs. It is characterized by its pentacyclic structure, which contributes to its diverse biological activities. Lupeol exhibits anti-inflammatory, antioxidant, and anticancer properties, making it of interest in pharmacological research. The compound is typically a white to pale yellow crystalline solid with low solubility in water but is soluble in organic solvents like ethanol and chloroform. Its molecular formula is C30H50O, and it has a relatively high molecular weight. Lupeol has been studied for its potential therapeutic effects, including its ability to inhibit tumor growth and modulate various signaling pathways involved in cancer progression. Additionally, it may possess antimicrobial properties, further enhancing its significance in natural product chemistry and potential applications in medicine. Overall, Lupeol represents a promising compound for further exploration in both nutritional and pharmaceutical contexts.
Formula:C30H50O
InChI:InChI=1S/C30H50O/c1-19(2)20-11-14-27(5)17-18-29(7)21(25(20)27)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h20-25,31H,1,9-18H2,2-8H3/t20-,21+,22-,23+,24-,25+,27+,28-,29+,30+/m0/s1
InChI key:InChIKey=MQYXUWHLBZFQQO-QGTGJCAVSA-N
SMILES:OC1CCC2(C)C(CCC3(C)C2CCC4C5C(C(=C)C)CCC5(C)CCC43C)C1(C)C
- Synonyms:
- (+)-Lupeol
- (3β)-Lup-20(29)-en-3-ol
- 1H-Cyclopenta[a]chrysene, lup-20(29)-en-3-ol deriv.
- 3β-Hydroxylup-20(29)-ene
- Clerodol
- Fagarasterol
- Fagarsterol
- Lup-20(29)-en-3β-ol
- Lupene-20(29) Ol-3, (3Β)-
- Lupenol
- See more synonyms
- Monogynol B
- Nsc 90487
- β-Viscol
- HSDB 7687
- Lup-20(29)-en-3-ol, (3beta)-
- Lup-20(29)-en-3-ol, (3β)-
- (3beta,14xi)-lup-20(29)-en-3-ol
- Lup-20(29)-en-3-ol, (3-beta)-
- Lup-20(29)-en-3beta-ol (8CI)
- beta-Viscol
- Monogynol B (6CI)
- (3-beta)-Lup-20(29)-en-3-ol
- Lup-20(29)-en-3-beta-ol (8CI)
- Triterpene lupeol
