CAS 545-48-2: (+)-Erythrodiol
Description:(+)-Erythrodiol, with the CAS number 545-48-2, is a naturally occurring triterpenoid alcohol that is primarily found in various plant species, particularly in the family of Euphorbiaceae. It is characterized by its molecular formula, which typically consists of carbon, hydrogen, and oxygen atoms, reflecting its structure as a pentacyclic compound. This substance is known for its potential biological activities, including anti-inflammatory and antioxidant properties, making it of interest in pharmacological research. (+)-Erythrodiol is often studied for its role in traditional medicine and its potential applications in cosmetics and health supplements due to its skin-conditioning effects. The compound is typically a white to off-white crystalline solid, and it is soluble in organic solvents but has limited solubility in water. Its stereochemistry, indicated by the (+) designation, refers to its specific spatial arrangement of atoms, which can influence its biological activity and interactions with other molecules. Overall, (+)-Erythrodiol represents a significant compound in both natural product chemistry and potential therapeutic applications.
Formula:C30H50O2
InChI:InChI=1S/C30H50O2/c1-25(2)14-16-30(19-31)17-15-28(6)20(21(30)18-25)8-9-23-27(5)12-11-24(32)26(3,4)22(27)10-13-29(23,28)7/h8,21-24,31-32H,9-19H2,1-7H3/t21-,22-,23+,24-,27-,28+,29+,30+/m0/s1
InChI key:InChIKey=PSZDOEIIIJFCFE-OSQDELBUSA-N
SMILES:OCC12CCC(C)(C)CC2C3=CCC4C5(C)CCC(O)C(C)(C)C5CCC4(C)C3(C)CC1
- Synonyms:
- (+)-Erythrodiol
- (3β)-Olean-12-ene-3,28-diol
- Olean-12-ene-3β,28-diol
- Olean-12-ene-3,28-diol, (3β)-
- Erythrodiol
