CymitQuimica logo

CAS 54525-19-8

:

(1-ethylpiperidin-3-yl)methanol

Description:
(1-Ethylpiperidin-3-yl)methanol, with the CAS number 54525-19-8, is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features an ethyl group attached to the nitrogen atom of the piperidine ring and a hydroxymethyl group (-CH2OH) at the 3-position of the ring. The presence of the hydroxymethyl group contributes to its potential as a polar compound, influencing its solubility in various solvents, particularly in polar solvents like water. The compound may exhibit basic properties due to the nitrogen atom, which can accept protons. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with various biological activities. Additionally, the compound's characteristics, such as boiling point, melting point, and reactivity, would depend on its specific molecular interactions and the presence of functional groups. Overall, (1-ethylpiperidin-3-yl)methanol is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C8H17NO
InChI:InChI=1/C8H17NO/c1-2-9-5-3-4-8(6-9)7-10/h8,10H,2-7H2,1H3
InChI key:UFFXQKBVALLYQW-UHFFFAOYSA-N
SMILES:CCN1CCCC(C1)CO
Found 3 products.