CAS 54526-94-2
:(2S,3S,4R)-4-[(6-Deoxy-2,4-di-O-methyl-α-L-mannopyranosyl)oxy]-3,4-dihydro-2,5,7-trihydroxy-3,9-dimethoxy-2-methyl-1,6,11(2H)-naphthacenetrione
Description:
The chemical substance with the name "(2S,3S,4R)-4-[(6-Deoxy-2,4-di-O-methyl-α-L-mannopyranosyl)oxy]-3,4-dihydro-2,5,7-trihydroxy-3,9-dimethoxy-2-methyl-1,6,11(2H)-naphthacenetrione" and CAS number 54526-94-2 is a complex organic compound characterized by its intricate structure, which includes a naphthacene backbone modified with various functional groups. This compound features multiple hydroxyl (-OH) groups, methoxy (-OCH3) groups, and a sugar moiety, specifically a deoxy-mannopyranosyl unit, which contributes to its solubility and potential biological activity. The stereochemistry indicated by the (2S,3S,4R) configuration suggests specific spatial arrangements of atoms that can influence the compound's reactivity and interactions with biological systems. Such compounds are often of interest in medicinal chemistry due to their potential therapeutic properties, including antimicrobial or anticancer activities. The presence of multiple functional groups also suggests that this compound could participate in various chemical reactions, making it a subject of interest for further research in organic synthesis and pharmacology.
Formula:C29H32O13
InChI:InChI=1S/C29H32O13/c1-10-23(38-4)22(34)25(39-5)28(41-10)42-24-18-14(26(35)29(2,36)27(24)40-6)9-13-17(21(18)33)20(32)16-12(19(13)31)7-11(37-3)8-15(16)30/h7-10,22-25,27-28,30,33-34,36H,1-6H3/t10-,22+,23-,24+,25+,27-,28-,29+/m0/s1
InChI key:InChIKey=VHJWDTPKSIFZBV-IDORXPLKSA-N
SMILES:O([C@@H]1C2=C(C=C3C(=C2O)C(=O)C=4C(C3=O)=CC(OC)=CC4O)C(=O)[C@@](C)(O)[C@H]1OC)[C@H]5[C@H](OC)[C@H](O)[C@@H](OC)[C@H](C)O5
Synonyms:- (2S,3S,4R)-4-[(6-Deoxy-2,4-di-O-methyl-α-L-mannopyranosyl)oxy]-3,4-dihydro-2,5,7-trihydroxy-3,9-dimethoxy-2-methyl-1,6,11(2H)-naphthacenetrione
- Steffimycin B
- NSC 204855
- 1,6,11(2H)-Naphthacenetrione, 4-[(6-deoxy-2,4-di-O-methyl-α-L-mannopyranosyl)oxy]-3,4-dihydro-2,5,7-trihydroxy-3,9-dimethoxy-2-methyl-, (2S,3S,4R)-
- 1,6,11(2H)-Naphthacenetrione, 4-[(6-deoxy-2,4-di-O-methyl-α-L-mannopyranosyl)oxy]-3,4-dihydro-2,5,7-trihydroxy-3,9-dimethoxy-2-methyl-, [2S-(2α,3α,4β)]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Steffimycin B
CAS:Steffimycin B is an anthracycline antibiotic, which is a metabolite produced by certain Streptomyces species. This compound functions by intercalating into DNA, thereby inhibiting the synthesis of nucleic acids and disrupting essential cellular processes. Its mode of action involves preventing the replication and transcription of bacterial DNA, leading to cell death. Steffimycin B has been primarily explored for its antibiotic properties, particularly in research settings for its potential to combat specific bacterial infections. Additionally, its structural similarities to other anthracyclines suggest potential use in studying mechanisms of drug resistance and interactions with DNA. Further investigation may reveal additional therapeutic applications or synergistic effects in combination with other antimicrobial agents.Formula:C29H32O13Purity:Min. 95%Molecular weight:588.6 g/mol
