CAS 5453-07-6

3-amino-5-methyl-1H-pyrazole-4-carbonitrile

Description:

3-Amino-5-methyl-1H-pyrazole-4-carbonitrile is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a cyano group (-C≡N) attached to the pyrazole ring, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the methyl group at the 5-position enhances its lipophilicity, which can influence its biological activity. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its chemical properties are influenced by the functional groups present, making it a candidate for further chemical modifications. Additionally, 3-amino-5-methyl-1H-pyrazole-4-carbonitrile may exhibit biological activities, such as antimicrobial or anti-inflammatory effects, which are of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₅H₆N₄

InChI: InChI=1/C5H6N4/c1-3-4(2-6)5(7)9-8-3/h1H3,(H3,7,8,9)

SMILES: Cc1c(C#N)c(=N)[nH][nH]1

Synonyms:

• 1H-pyrazole-4-carbonitrile, 5-amino-3-methyl-
• 5-Amino-3-methyl-1H-pyrazole-4-carbonitrile

3-Amino-4-cyano-5-methylpyrazole

CAS: 5453-07-6

Formula: C₅H₆N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 122.1279

Ref: IN-DA00DACP

3-Amino-4-cyano-5-methylpyrazole

CAS: 5453-07-6

3-Amino-4-cyano-5-methylpyrazole

Formula: C₅H₆N₄

Purity: 95%

Color and Shape: brown solid

Molecular weight: 122.13g/mol

Ref: 54-OR300740

5-Amino-3-methyl-1H-pyrazole-4-carbonitrile

CAS: 5453-07-6

Formula: C₅H₆N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 122.131

Ref: 10-F236934