CAS 5453-51-0

2-[4-(benzyloxy)benzylidene]-N-(pyridin-3-yl)hydrazinecarbothioamide

Description:

2-[4-(Benzyloxy)benzylidene]-N-(pyridin-3-yl)hydrazinecarbothioamide is a chemical compound characterized by its complex structure, which includes a hydrazinecarbothioamide functional group and a benzylidene moiety. This compound features a pyridine ring, which contributes to its potential biological activity, and a benzyloxy group that enhances its solubility and stability. The presence of the hydrazine functional group suggests potential reactivity, particularly in forming coordination complexes or undergoing condensation reactions. The compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, which are common in hydrazine derivatives. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Additionally, the compound's solubility and stability in different solvents can be affected by the substituents on the aromatic rings. Overall, this compound represents a class of organic molecules with potential applications in medicinal chemistry and material science.

Formula: C₂₀H₁₈N₄OS

InChI: InChI=1/C20H18N4OS/c26-20(23-18-7-4-12-21-14-18)24-22-13-16-8-10-19(11-9-16)25-15-17-5-2-1-3-6-17/h1-14H,15H2,(H2,23,24,26)

SMILES: c1ccc(cc1)COc1ccc(cc1)C=NNC(=Nc1cccnc1)S

5-[(1H-indol-3-yl)methylidene]imidazolidine-2,4-dione

CAS: 5453-51-0

5-[(1H-indol-3-yl)methylidene]imidazolidine-2,4-dione

Purity: ≥90%

Molecular weight: 227.22g/mol

Ref: 54-BUP02040

5-[(1H-indol-3-yl)methylidene]imidazolidine-2,4-dione

CAS: 5453-51-0

5-[(1H-indol-3-yl)methylidene]imidazolidine-2,4-dione ((4Z)-4-(1H-indol-3-ylmethylidene)-4H-imidazole-2,5-diol) is a marine derived natural products found in

Formula: C₁₂H₉N₃O₂

Purity: 99.97%

Color and Shape: Solid

Molecular weight: 227.22

Ref: TM-TN7149