CAS 54534-92-8

4-(1H-imidazol-2-ylmethyl)morpholine

Description:

4-(1H-imidazol-2-ylmethyl)morpholine, with the CAS number 54534-92-8, is a chemical compound characterized by its unique structural features, which include a morpholine ring and an imidazole moiety. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar solvents like water and organic solvents. It is known for its potential biological activity, often studied in the context of medicinal chemistry for its role as a pharmacophore in drug design. The presence of both the morpholine and imidazole groups suggests that it may participate in hydrogen bonding and other interactions, making it a candidate for various applications, including as a ligand in coordination chemistry or as a building block in organic synthesis. Additionally, its stability under standard laboratory conditions and its reactivity with electrophiles or nucleophiles can be of interest in synthetic pathways. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.

Formula: C₈H₁₃N₃O

InChI: InChI=1/C8H13N3O/c1-2-10-8(9-1)7-11-3-5-12-6-4-11/h1-2H,3-7H2,(H,9,10)

SMILES: c1c[nH]c(CN2CCOCC2)n1

4-[(1H-Imidazol-2-yl)methyl]morpholine

CAS: 54534-92-8

Versatile small molecule scaffold

Formula: C₈H₁₃N₃O

Purity: Min. 95%

Molecular weight: 167.21 g/mol

Ref: 3D-ECA53492