CAS 54542-51-7
:Quercetin 3-O-(6-O-acetyl-β-D-glucopyranoside)
Description:
Quercetin 3-O-(6-O-acetyl-β-D-glucopyranoside) is a flavonoid glycoside derived from quercetin, a well-known plant pigment with antioxidant properties. This compound features a quercetin backbone linked to a glucopyranoside moiety, which is further acetylated at the 6-O position. Its chemical structure contributes to its solubility and bioavailability, enhancing its potential health benefits. Quercetin and its derivatives are recognized for their anti-inflammatory, antioxidant, and potential anticancer activities. The presence of the acetyl group may influence the compound's stability and absorption in biological systems. Quercetin 3-O-(6-O-acetyl-β-D-glucopyranoside) is often studied in the context of natural products and herbal medicine, as it is found in various fruits, vegetables, and medicinal plants. Its CAS number, 54542-51-7, is used for identification in chemical databases and regulatory contexts. Overall, this compound exemplifies the diverse roles of flavonoids in health and nutrition, warranting further investigation into its pharmacological properties and applications.
Formula:C23H22O13
InChI:InChI=1S/C23H22O13/c1-8(24)33-7-15-17(29)19(31)20(32)23(35-15)36-22-18(30)16-13(28)5-10(25)6-14(16)34-21(22)9-2-3-11(26)12(27)4-9/h2-6,15,17,19-20,23,25-29,31-32H,7H2,1H3/t15-,17-,19+,20-,23+/m1/s1
InChI key:InChIKey=IGLUNMMNDNWZOA-LNNZMUSMSA-N
SMILES:O(C1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC(O)=C(O)C=C3)[C@@H]4O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]4O
Synonyms:- Quercetin 3-O-(6-O-acetyl-β-D-glucopyranoside)
- 3,3′,4′,5,7-Pentahydroxyflavone 3-(6′′-O-acetyl-β-D-glucopyranoside)
- 4H-1-Benzopyran-4-one, 3-[(6-O-acetyl-β-D-glucopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-
- Quercetin 3-O-(6-acetylglucoside)
- 3-[(6-O-Acetyl-β-D-glucopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Quercetin-3-O-(6-acetylglucoside)
CAS:Quercetin-3-O-(6-acetylglucoside) analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C23H22O13Purity:(HPLC) ≥85%Color and Shape:PowderMolecular weight:506.42QUERCETIN-3-O-β-D-GLUCOPYRANOSYL-6''-ACETATE
CAS:Formula:C23H22O13Purity:98%Molecular weight:506.4130Quercetin-3-O-glucose-6''-acetate
CAS:Quercetin-3-O-glucose-6''-acetatePurity:≥95%Molecular weight:506.41g/molQuercetin-3-O-glucose-6''-acetate
CAS:Quercetin-3-O-glucose-6''-acetate (6"-O-Acetylisoquercitrin) is an inhibitor of NADPH oxidase. Quercetin-3-O-glucose-6''-acetate has antioxidant activities.Formula:C23H22O13Purity:97.48%Color and Shape:SolidMolecular weight:506.41Quercetin-3-O-beta-D-glucopyranosyl-6-acetate
CAS:Quercetin-3-O-beta-D-glucopyranosyl-6-acetate is a glycosylated flavonoid compound, which is a naturally occurring plant metabolite. This compound is predominantly sourced from various plant species, where it acts as a secondary metabolite contributing to plant defense mechanisms. The mode of action of Quercetin-3-O-beta-D-glucopyranosyl-6-acetate involves its ability to function as an antioxidant, scavenging free radicals and reducing oxidative stress in biological systems. Additionally, its glycosylated structure may enhance its solubility and stability, facilitating better bioavailability compared to non-glycosylated counterparts.Formula:C23H22O13Purity:Min. 95%Color and Shape:PowderMolecular weight:506.41 g/molQuercetin-3-O-β-D-glucopyranosyl-6
CAS:Controlled ProductFormula:C23H22O13Color and Shape:NeatMolecular weight:506.41






