CAS 54549-23-4
:D-Glucoside, octyl
Description:
D-Glucoside, octyl, with the CAS number 54549-23-4, is a non-ionic surfactant derived from glucose. It is characterized by its hydrophilic (water-attracting) glucose moiety and a hydrophobic (water-repelling) octyl group, which contributes to its surfactant properties. This compound is typically used in various applications, including cosmetics, personal care products, and food processing, due to its ability to enhance solubility and stability of formulations. D-Glucoside, octyl is known for being biodegradable and environmentally friendly, making it a preferred choice in formulations aimed at sustainability. It exhibits good emulsifying, wetting, and dispersing properties, which are essential for improving the texture and performance of products. Additionally, it is generally considered safe for use in consumer products, although specific safety data should be consulted for particular applications. Overall, D-Glucoside, octyl serves as a versatile ingredient in both industrial and consumer applications, leveraging its unique chemical structure to enhance product efficacy.
Formula:C14H28O6
InChI:InChI=1/C14H27O6/c1-2-3-4-5-6-7-8-19-13-12(17)11(16)10(9-15)20-14(13)18/h10-17H,2-9H2,1H3/q-1/t10-,11-,12+,13-,14?/m1/s1
Synonyms:- <span class="text-smallcaps">D</span>-Glucoside, octyl
- Octyl-D-glucopyranoside
- D-Glucoside, octyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Octyl D-glucopyranoside
CAS:<p>Octyl D-glucopyranoside is a glucoside that is used as an analytical reagent. It has been shown to have detergent properties and can be used for the extraction of proteins. Octyl D-glucopyranoside also has a high binding affinity for guanine nucleotides, protein, and glycol ethers. The rate constant for the reaction between octyl D-glucopyranoside with the guanine nucleotide was found to be 0.25 x 10^(-5) s^(-1). This product can be used in biochemical research and chromatographic analysis.</p>Formula:C14H28O6Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:292.37 g/mol
