CAS 54549-23-4: D-Glucoside, octyl

Description:D-Glucoside, octyl, with the CAS number 54549-23-4, is a non-ionic surfactant derived from glucose. It is characterized by its hydrophilic (water-attracting) glucose moiety and a hydrophobic (water-repelling) octyl group, which contributes to its surfactant properties. This compound is typically used in various applications, including cosmetics, personal care products, and food processing, due to its ability to enhance solubility and stability of formulations. D-Glucoside, octyl is known for being biodegradable and environmentally friendly, making it a preferred choice in formulations aimed at sustainability. It exhibits good emulsifying, wetting, and dispersing properties, which are essential for improving the texture and performance of products. Additionally, it is generally considered safe for use in consumer products, although specific safety data should be consulted for particular applications. Overall, D-Glucoside, octyl serves as a versatile ingredient in both industrial and consumer applications, leveraging its unique chemical structure to enhance product efficacy.

Formula:C₁₄H₂₈O₆

InChI:InChI=1/C14H27O6/c1-2-3-4-5-6-7-8-19-13-12(17)11(16)10(9-15)20-14(13)18/h10-17H,2-9H2,1H3/q-1/t10-,11-,12+,13-,14?/m1/s1