CAS 5455-34-5

5,5-diethylimidazolidine-2,4-dione

Description:

5,5-Diethylimidazolidine-2,4-dione, also known as diethyl hydantoin, is a cyclic urea derivative characterized by its five-membered ring structure containing two carbonyl groups and two ethyl substituents. This compound is typically a white to off-white crystalline solid, exhibiting moderate solubility in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. It is known for its stability under standard conditions and can undergo various chemical reactions, including nucleophilic substitutions and cyclization. The presence of the imidazolidine ring contributes to its potential biological activity, making it of interest in pharmaceutical applications. Additionally, it may serve as a building block in organic synthesis due to its functional groups. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose risks if ingested or inhaled. Overall, 5,5-diethylimidazolidine-2,4-dione is a versatile compound with applications in medicinal chemistry and organic synthesis.

Formula: C₇H₁₂N₂O₂

InChI: InChI=1/C7H12N2O2/c1-3-7(4-2)5(10)8-6(11)9-7/h3-4H2,1-2H3,(H2,8,9,10,11)

SMILES: CCC1(CC)C(=NC(=N1)O)O

Synonyms:

• 2,4-Imidazolidinedione, 5,5-Diethyl-
• 5,5-Diethyl-imidazolidine-2,4-dione
• 5,5-Diethylimidazolidine-2,4-dione

5,5-Diethyl-imidazolidine-2,4-dione

CAS: 5455-34-5

5,5-Diethyl-imidazolidine-2,4-dione

Purity: 95%

Color and Shape: Solid

Molecular weight: 156.18g/mol

Ref: 54-OR965625

5,5-Diethylimidazolidine-2,4-dione

CAS: 5455-34-5

Formula: C₇H₁₂N₂O₂

Purity: 95.0%

Molecular weight: 156.185

Ref: 10-F431353

5,5-Diethyl-imidazolidine-2,4-dione

CAS: 5455-34-5

5,5-Diethyl-imidazolidine-2,4-dione is an n-nitrosodiethylamine (NDELA) metabolite that binds to the cytochrome P450 enzyme and inhibits the activity of hydantoinase. It is also a ligand for the immunoreactive form of the enzyme in rats. 5,5-Diethyl-imidazolidine-2,4-dione has been shown to inhibit carcinogenesis in rats and enhance enzyme activities. This compound also interacts with drugs such as warfarin and phenytoin by enhancing their concentrations.

Formula: C₇H₁₂N₂O₂

Purity: Min. 95%

Molecular weight: 156.18 g/mol

Ref: 3D-FAA45534