CAS 5455-65-2
:5,5-dimethyl-2-(2-methylpropyl)-1,3-dioxane
Description:
5,5-Dimethyl-2-(2-methylpropyl)-1,3-dioxane is an organic compound characterized by its dioxane structure, which features a six-membered ring containing two oxygen atoms. This compound is a derivative of dioxane, known for its cyclic ether properties. The presence of multiple alkyl groups, specifically two methyl groups and a branched isopropyl group, contributes to its hydrophobic nature and influences its physical properties, such as boiling point and solubility. Typically, compounds like this exhibit moderate volatility and may have applications in organic synthesis or as solvents. The dioxane ring can also participate in various chemical reactions, making it a versatile intermediate in organic chemistry. Safety considerations are important, as dioxane derivatives can pose health risks, including potential carcinogenicity. Therefore, handling should be done with appropriate precautions in a controlled environment. Overall, 5,5-dimethyl-2-(2-methylpropyl)-1,3-dioxane exemplifies the complexity and utility of cyclic ethers in chemical applications.
Formula:C10H20O2
InChI:InChI=1/C10H20O2/c1-8(2)5-9-11-6-10(3,4)7-12-9/h8-9H,5-7H2,1-4H3
SMILES:CC(C)CC1OCC(C)(C)CO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Isobutyl-5,5-dimethyl-1,3-dioxane
CAS:Controlled ProductFormula:C10H20O2Color and Shape:NeatMolecular weight:172.265
