CAS 5455-67-4

2-hydroxy-N-methyl-N-phenylpropanamide

Description:

2-Hydroxy-N-methyl-N-phenylpropanamide, also known as a derivative of propanamide, features a hydroxyl group (-OH) and a methyl group attached to a nitrogen atom, along with a phenyl group. This compound is characterized by its amide functional group, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and organic synthesis. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its biological activity. The molecular structure suggests that it may exhibit hydrogen bonding capabilities, affecting its physical properties such as melting and boiling points. Additionally, the phenyl group can impart aromatic characteristics, potentially influencing the compound's interactions with biological systems. As with many amides, it may exhibit moderate stability under standard conditions but could be susceptible to hydrolysis under acidic or basic conditions. Overall, 2-hydroxy-N-methyl-N-phenylpropanamide is a compound of interest for its potential applications and unique structural features.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1/C10H13NO2/c1-8(12)10(13)11(2)9-6-4-3-5-7-9/h3-8,12H,1-2H3

SMILES: CC(C(=O)N(C)c1ccccc1)O

2-Hydroxy-N-methyl-N-phenylpropanamide

CAS: 5455-67-4

Versatile small molecule scaffold

Formula: C₁₀H₁₃NO₂

Purity: Min. 95%

Molecular weight: 179.22 g/mol

Ref: 3D-FAA45567