CAS 5455-94-7
:dihydro-2,2,5,5-tetramethyl-3(2H)-furanone
Description:
Dihydro-2,2,5,5-tetramethyl-3(2H)-furanone, also known by its CAS number 5455-94-7, is an organic compound characterized by its furanone structure, which includes a five-membered lactone ring. This compound is typically a colorless to pale yellow liquid with a sweet, creamy odor, often associated with various food flavors and fragrances. It is soluble in organic solvents and exhibits low solubility in water. The molecular structure features multiple methyl groups, contributing to its stability and unique sensory properties. Dihydro-2,2,5,5-tetramethyl-3(2H)-furanone is primarily used in the food and fragrance industries, where it serves as a flavoring agent and aroma compound. Its pleasant scent makes it a valuable additive in products such as baked goods, dairy items, and perfumes. Additionally, it may have applications in chemical synthesis and research due to its distinctive structural features. Safety data indicates that, while it is generally regarded as safe in food applications, standard handling precautions should be observed.
Formula:C8H14O2
InChI:InChI=1/C8H14O2/c1-7(2)5-6(9)8(3,4)10-7/h5H2,1-4H3
SMILES:CC1(C)CC(=O)C(C)(C)O1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,2,5,5-Tetramethyltetrahydrofuran-3-one
CAS:Formula:C8H14O2Purity:97%Color and Shape:LiquidMolecular weight:142.19562,2,5,5-Tetramethyldihydrofuran-3(2H)-one
CAS:2,2,5,5-Tetramethyldihydrofuran-3(2H)-onePurity:≥95%Molecular weight:142.20g/mol2,2,5,5-Tetramethyldihydrofuran-3(2H)-one
CAS:<p>2,2,5,5-Tetramethyldihydrofuran-3(2H)-one is an organic compound that is classified as a heterocyclic compound. This substance has been shown to be a good mercurial reagent and can be used for the synthesis of polycyclic compounds. 2,2,5,5-Tetramethyldihydrofuran-3(2H)-one has been shown to form a dimer with sulfuric acid in the presence of polyphosphoric acid. It also reacts with ethers to form sulfates and furans.</p>Formula:C8H14O2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:142.2 g/mol2,2,5,5-Tetramethyldihydrofuran-3(2H)-one
CAS:Formula:C8H14O2Purity:95%Color and Shape:ClearMolecular weight:142.1982,2,5,5-Tetramethyloxolan-3-one
CAS:Controlled Product<p>Applications 2,2,5,5-Tetramethyloxolan-3-one is a reagent that is used in the synthesis of 6-Hydroxy Bexarotene (H817500), which is a metabolite of Bexarotene (B336750).<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Hashimoto, S., et al.: Xenobiotica, 24, 1177 ( 1994), Boehm, M., et al.: J. Med. Chem., 38, 3146 (1995), Shirley, M.A., et al.: Drug Metab. Dispos., 25, 1144 (1997),<br></p>Formula:C8H14O2Color and Shape:NeatMolecular weight:142.2




