CAS 54551-83-6
:Methyl 2,6-dichlorobenzeneacetate
Description:
Methyl 2,6-dichlorobenzeneacetate is an organic compound characterized by its ester functional group, derived from the reaction of 2,6-dichlorobenzoic acid and methanol. It features a benzene ring substituted with two chlorine atoms at the 2 and 6 positions, which contributes to its chemical stability and influences its reactivity. The presence of the acetate group enhances its solubility in organic solvents, making it useful in various applications, including as an intermediate in organic synthesis and in the production of agrochemicals or pharmaceuticals. This compound typically exhibits a moderate boiling point and melting point, reflecting its molecular weight and structure. Additionally, it may possess certain toxicological properties due to the chlorine substituents, necessitating careful handling and storage. Overall, Methyl 2,6-dichlorobenzeneacetate is a valuable compound in chemical research and industrial applications, with its unique structural features imparting specific chemical behaviors.
Formula:C9H8Cl2O2
InChI:InChI=1S/C9H8Cl2O2/c1-13-9(12)5-6-7(10)3-2-4-8(6)11/h2-4H,5H2,1H3
InChI key:InChIKey=FCWRUYPZZJPCCG-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C1=C(Cl)C=CC=C1Cl
Synonyms:- 2,6-Dichlorophenylacetic acid methyl ester
- Benzeneacetic acid, 2,6-dichloro-, methyl ester
- Methyl (2,6-dichlorophenyl)acetate
- Methyl 2,6-dichlorobenzeneacetate
- Methyl 2-(2,6-dichlorophenyl)acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Methyl 2,6-Dichlorophenylacetate
CAS:Formula:C9H8Cl2O2Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:219.06Methyl 2-(2,6-dichlorophenyl)acetate
CAS:Formula:C9H8Cl2O2Purity:96%Color and Shape:LiquidMolecular weight:219.0646Methyl 2-(2,6-dichlorophenyl)acetate
CAS:Methyl 2-(2,6-dichlorophenyl)acetatePurity:98%Molecular weight:219.06g/mol2,6-Dichlorophenylacetic Acid Methyl Ester
CAS:Controlled ProductApplications Intermediate in the preparation of Guanfacine
Formula:C9H8Cl2O2Color and Shape:NeatMolecular weight:219.062,6-Dichlorophenylacetic acid methyl ester
CAS:2,6-Dichlorophenylacetic acid methyl ester is a diphenyl ether derivative that is synthesised by reducing 2,6-dichlorobenzaldehyde with lithium borohydride in the presence of benzyl alcohol and guanidine carbonate. It has been used as an anaesthetic in veterinary medicine and as a functional group.Formula:C9H8Cl2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:219.06 g/molMethyl 2,6-dichlorophenylacetate
CAS:Formula:C9H8Cl2O2Purity:96%Color and Shape:ClearMolecular weight:219.06







