CAS 5457-70-5: 2-Phenylethyl octanoate

Description:2-Phenylethyl octanoate, with the CAS number 5457-70-5, is an ester formed from the reaction of 2-phenylethanol and octanoic acid. This compound typically appears as a colorless to pale yellow liquid with a pleasant, floral aroma, making it useful in the fragrance and flavor industries. It has a relatively low volatility, which contributes to its stability and longevity in formulations. The molecular structure features a phenyl group attached to an ethyl chain, which is further connected to an octanoate group, imparting both hydrophobic and lipophilic characteristics. This dual nature allows it to be soluble in various organic solvents while being less soluble in water. 2-Phenylethyl octanoate is often utilized in perfumes, cosmetics, and food flavorings due to its aromatic properties. Additionally, it may exhibit some antimicrobial activity, making it of interest in food preservation and safety applications. As with many esters, it is generally considered to have low toxicity, but safety data should always be consulted for specific applications.

Formula:C₁₆H₂₄O₂

InChI:InChI=1S/C16H24O2/c1-2-3-4-5-9-12-16(17)18-14-13-15-10-7-6-8-11-15/h6-8,10-11H,2-5,9,12-14H2,1H3

InChI key:InChIKey=ASETYIALRXDVDF-UHFFFAOYSA-N

SMILES:O=C(OCCC=1C=CC=CC1)CCCCCCC

Synonyms:
2-Phenethyl octanoate
2-Phenylethyl Octanoate
NSC 23950
Octanoic acid, 2-phenylethyl ester
Octanoic acid, phenethyl ester
Phenethyl octanoate
Phenylethyl-Caprylate
β-Phenylethyl octanoate

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-Phenylethyl n-Octanoate REF: 3B-P2741CAS: 5457-70-5	>98.0%(GC)	38.00 €~96.00 €	Mon 07 Apr 25
Phenethyl octanoate REF: IN-DA003TO3CAS: 5457-70-5	98%	To inquire	Mon 14 Apr 25
2-Phenylethyl N-Octanoate REF: 54-OR1029426CAS: 5457-70-5	98%	32.00 €~3,811.00 €	Tue 15 Apr 25
2-Phenylethyl n-Octanoate REF: 3D-FAA45770CAS: 5457-70-5	Min. 95%	- - -	Discontinued product