CAS 54582-34-2

1-(4-methylbenzyl)urea

Description:

1-(4-Methylbenzyl)urea, with the CAS number 54582-34-2, is an organic compound characterized by the presence of a urea functional group attached to a 4-methylbenzyl moiety. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. Its molecular structure features a urea group (NH2) connected to a benzyl group that has a methyl substituent at the para position, which influences its physical and chemical properties. The presence of the aromatic ring contributes to its stability and potential interactions in various chemical environments. 1-(4-Methylbenzyl)urea may exhibit biological activity, making it of interest in pharmaceutical research and development. Additionally, its properties can be influenced by factors such as temperature and pH, which may affect its solubility and reactivity. Overall, this compound serves as a useful building block in organic synthesis and may have applications in various fields, including medicinal chemistry and materials science.

Formula: C₉H₁₂N₂O

InChI: InChI=1/C9H12N2O/c1-7-2-4-8(5-3-7)6-11-9(10)12/h2-5H,6H2,1H3,(H3,10,11,12)

SMILES: Cc1ccc(cc1)CNC(=N)O

[(4-Methylphenyl)methyl]urea

CAS: 54582-34-2

Formula: C₉H₁₂N₂O

Molecular weight: 164.2044

Ref: IN-DA00DCM3

[(4-Methylphenyl)methyl]urea

CAS: 54582-34-2

[(4-Methylphenyl)methyl]urea

Purity: 95%

Molecular weight: 164.20g/mol

Ref: 54-OR33121

N-(4-Methylbenzyl)urea

CAS: 54582-34-2

Versatile small molecule scaffold

Formula: C₉H₁₂N₂O

Purity: Min. 95%

Molecular weight: 164.2 g/mol

Ref: 3D-ECA58234