CAS 54587-50-7
:2-[(1-methylethyl)amino]-1-[(2-prop-2-en-1-ylphenoxy)methyl]ethyl beta-D-glucopyranosiduronic acid
Description:
2-[(1-methylethyl)amino]-1-[(2-prop-2-en-1-ylphenoxy)methyl]ethyl beta-D-glucopyranosiduronic acid, with CAS number 54587-50-7, is a complex organic compound characterized by its unique structural features. It contains a glucopyranosiduronic acid moiety, which is a sugar derivative that contributes to its solubility and potential biological activity. The presence of an isopropyl amino group suggests that it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. Additionally, the alkenylphenoxy group indicates that the compound may possess unique reactivity and could participate in various chemical reactions, including those involving electrophilic or nucleophilic species. This compound's structure implies potential applications in medicinal chemistry, particularly in drug design, due to its ability to interact with biological systems. Its properties, such as solubility, stability, and reactivity, would be influenced by the functional groups present, making it a subject of interest for further research in both synthetic and medicinal chemistry.
Formula:C21H31NO8
InChI:InChI=1/C21H31NO8/c1-4-7-13-8-5-6-9-15(13)28-11-14(10-22-12(2)3)29-21-18(25)16(23)17(24)19(30-21)20(26)27/h4-6,8-9,12,14,16-19,21-25H,1,7,10-11H2,2-3H3,(H,26,27)/t14?,16-,17-,18+,19-,21+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Alprenolol glucuronide
CAS:Alprenolol glucuronide is the glucoronide salt of Aprenolol --- a beta blocker.Formula:C21H31NO8Color and Shape:SolidMolecular weight:425.47
