CAS 546-28-1
:(+)-β-Cedrene
Description:
(+)-β-Cedrene is a naturally occurring sesquiterpene hydrocarbon, primarily found in various essential oils, particularly those derived from cedarwood and other coniferous trees. It is characterized by its distinct woody and earthy aroma, making it a valuable component in the fragrance and flavor industries. The molecular formula of (+)-β-Cedrene is C15H24, and it features a complex bicyclic structure that contributes to its unique properties. This compound is typically a colorless to pale yellow liquid at room temperature and is insoluble in water but soluble in organic solvents. (+)-β-Cedrene exhibits low toxicity and is generally regarded as safe for use in perfumery and cosmetics. Additionally, it has been studied for its potential biological activities, including antimicrobial and anti-inflammatory properties. Its chiral nature, with a specific optical rotation, distinguishes it from its isomers, making it significant in both natural product chemistry and industrial applications.
Formula:C15H24
InChI:InChI=1S/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h11-13H,1,5-9H2,2-4H3/t11-,12+,13+,15+/m1/s1
InChI key:InChIKey=DYLPEFGBWGEFBB-OSFYFWSMSA-N
SMILES:C[C@H]1[C@@]23[C@](C(C)(C)[C@@](C2)(C(=C)CC3)[H])(CC1)[H]
Synonyms:- (+)-β-Cedrene
- (+)-β-Funebrene
- (3R,3aS,7S,8aS)-Octahydro-3,8,8-trimethyl-6-methylene-1H-3a,7-methanoazulene
- (3R-(3alpha,3Abeta,7beta,8aalpha))-octahydro-3,8,8-trimethyl-6-methylene-1H-3a,7-methanoazulene
- 1H-3a,7-Methanoazulene, octahydro-3,8,8-trimethyl-6-methylene-, (3R,3aS,7S,8aS)-
- 1H-3a,7-Methanoazulene, octahydro-3,8,8-trimethyl-6-methylene-, (3R-(3alpha,3abeta,7beta,8aalpha))-
- 1H-3a,7-Methanoazulene, octahydro-3,8,8-trimethyl-6-methylene-, [3R-(3α,3aβ,7β,8aα)]-
- Cedr-8(15)-Ene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
β-Cedrene
CAS:β-Cedrene ((+)-β-Cedrene), a sesquiterpene isolated from both Centaurea kotschyi var. kotschyi and Centaurea kotschyi var. decumbens, exhibits a broad range of biological activities, including antibacterial, anti-inflammatory, antispasmodic, tonic, diuretic, sedative, insecticidal, and antifungal properties. Additionally, β-Cedrene acts as a potent competitive inhibitor of the CYP2B6-mediated bupropion hydroxylase activity, demonstrating a K i value of 1.6 μM [1] [2].Formula:C15H24Color and Shape:SolidMolecular weight:204.35(+)-β-Cedrene (major, contains (-)-cedrene)
CAS:Controlled ProductFormula:C15H24Color and Shape:NeatMolecular weight:204.35(+)-β-Cedrene
CAS:(+)-β-Cedrene is a bicyclic sesquiterpene, which is a type of terpenoid compound commonly found in essential oils. It is derived primarily from the essential oil of cedar trees, among other coniferous species. This compound is formed through the complex biosynthetic pathways of the plant, involving the cyclization of farnesyl pyrophosphate, a key intermediate in terpene biosynthesis.Formula:C15H24Purity:Min. 95%Molecular weight:204.35 g/mol




