CymitQuimica logo

CAS 54608-96-7

:

3-(4-nitrophenyl)-5-(thiophen-2-yl)-1,2,4-oxadiazole

Description:
3-(4-Nitrophenyl)-5-(thiophen-2-yl)-1,2,4-oxadiazole is a heterocyclic organic compound characterized by its oxadiazole ring, which contains nitrogen and oxygen atoms. This compound features a 4-nitrophenyl group and a thiophen-2-yl group, contributing to its unique chemical properties and potential applications. The presence of the nitro group typically imparts electron-withdrawing characteristics, influencing the compound's reactivity and stability. The thiophene moiety adds aromaticity and can enhance the compound's electronic properties, making it of interest in materials science, particularly in organic electronics and photonic applications. The oxadiazole structure is known for its fluorescence and potential use in light-emitting devices. Additionally, the compound may exhibit biological activity, making it a candidate for further pharmacological studies. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. Overall, this compound represents a versatile structure with potential applications in various fields, including organic synthesis, materials science, and medicinal chemistry.
Formula:C12H7N3O3S
InChI:InChI=1/C12H7N3O3S/c16-15(17)9-5-3-8(4-6-9)11-13-12(18-14-11)10-2-1-7-19-10/h1-7H
SMILES:c1cc(c2nc(c3ccc(cc3)N(=O)=O)no2)sc1
Synonyms:
  • 1,2,4-Oxadiazole, 3-(4-nitrophenyl)-5-(2-thienyl)-
  • 3-(4-Nitrophenyl)-5-(2-thienyl)-1,2,4-oxadiazole
  • 3-(4-Nitro-phenyl)-5-thiophen-2-yl-[1,2,4]oxadiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.