CAS 546086-95-7

2,8-diazaspiro[4.5]decan-1-one

Description:

2,8-Diazaspiro[4.5]decan-1-one is a bicyclic compound characterized by its unique spiro structure, which consists of two rings sharing a single atom. This compound features two nitrogen atoms incorporated into its framework, contributing to its diaza designation. The presence of a carbonyl group (ketone) at the 1-position of the spiro system is significant for its reactivity and potential applications in organic synthesis. The spirocyclic nature of the molecule often imparts interesting conformational properties and can influence its biological activity. Typically, compounds like 2,8-diazaspiro[4.5]decan-1-one may exhibit diverse pharmacological properties, making them of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular structure. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which can be exploited in synthetic organic chemistry.

Formula: C₈H₁₄N₂O

InChI: InChI=1/C8H14N2O/c11-7-8(3-6-10-7)1-4-9-5-2-8/h9H,1-6H2,(H,10,11)

SMILES: C1CNCCC21CCN=C2O

Synonyms:

• 2,8-Diaza-Spiro[4,5]Decan-1-One
• 2,8-Diazaspiro[4.5]decan-1-one

2,8-Diazaspiro[4.5]decan-1-one

CAS: 546086-95-7

Formula: C₈H₁₄N₂O

Molecular weight: 154.2096

Ref: IN-DA00DHX1

2,8-Diazaspiro[4.5]decan-1-one

CAS: 546086-95-7

2,8-Diazaspiro[4.5]decan-1-one

Purity: ≥95%

Molecular weight: 154.21g/mol

Ref: 54-OR52407