CymitQuimica logo

CAS 5461-23-4

:

4-[(4-nitrophenyl)sulfinyl]aniline

Description:
4-[(4-Nitrophenyl)sulfinyl]aniline, with the CAS number 5461-23-4, is an organic compound characterized by the presence of both an aniline group and a sulfinyl moiety attached to a para-nitrophenyl group. This compound typically exhibits a yellow crystalline appearance due to the nitro group, which can influence its electronic properties and reactivity. The sulfinyl group introduces a sulfur atom bonded to an oxygen atom, contributing to the compound's potential as a nucleophile or electrophile in various chemical reactions. The presence of the nitro group enhances the compound's electron-withdrawing characteristics, which can affect its solubility and reactivity in different solvents. Additionally, 4-[(4-nitrophenyl)sulfinyl]aniline may have applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of dyes and pigments. Safety data should be consulted, as compounds containing nitro groups can be hazardous and may require careful handling.
Formula:C12H10N2O3S
InChI:InChI=1/C12H10N2O3S/c13-9-1-5-11(6-2-9)18(17)12-7-3-10(4-8-12)14(15)16/h1-8H,13H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.