
CAS 54610-70-7
:thiophene-2-carboximidamide hydrochloride
Description:
Thiophene-2-carboximidamide hydrochloride is a chemical compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features a carboximidamide functional group, which contributes to its reactivity and potential applications in various chemical reactions. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in polar solvents. The presence of the imidamide group suggests that it may exhibit properties such as hydrogen bonding and potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, thiophene derivatives are known for their electronic properties, which can be leveraged in organic electronics and materials science. The compound's CAS number, 54610-70-7, allows for precise identification and retrieval of information in chemical databases. Overall, thiophene-2-carboximidamide hydrochloride is a versatile compound with potential applications in pharmaceuticals and materials science, owing to its unique structural features and functional groups.
Formula:C5H7ClN2S
InChI:InChI=1/C5H6N2S.ClH/c6-5(7)4-2-1-3-8-4;/h1-3H,(H3,6,7);1H
SMILES:c1cc(C(=N)N)sc1.Cl
Synonyms:- 2-Amidinothiophene Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Thiophene-2-carboxamidine hydrochloride
CAS:Thiophene-2-carboxamidine hydrochlorideFormula:C5H6N2S·ClHPurity:95Color and Shape: white crystalline solidMolecular weight:162.64g/molThiophene-2-amidine hydrochloride
CAS:<p>2-Amidinothiophene Hydrochloride is a drug that is used as an anti-inflammatory agent. It is an isoform of amidinothiophene, which inhibits the production and release of cyclic nucleotides. 2-Amidinothiophene Hydrochloride has shown activity against tracheal muscle, adenosine receptors, and phosphodiesterase isoenzymes. This drug binds to the ATP binding site of the enzyme cyclic nucleotide phosphodiesterase, blocking the breakdown of cAMP into AMP and then ADP.</p>Formula:C5H7ClN2SPurity:Min. 95%Molecular weight:162.64 g/mol2-Amidinothiophene hydrochloride
CAS:Formula:C5H7ClN2SPurity:95.0%Color and Shape:Solid, White powderMolecular weight:162.64


