CAS 546111-97-1
:N-[4-(2,2-Dimethyl-1-oxopropyl)-5-[[[[2-(ethylamino)ethyl]sulfonyl]amino]methyl]-4,5-dihydro-5-phenyl-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide
Description:
N-[4-(2,2-Dimethyl-1-oxopropyl)-5-[[[[2-(ethylamino)ethyl]sulfonyl]amino]methyl]-4,5-dihydro-5-phenyl-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide, with CAS number 546111-97-1, is a synthetic organic compound characterized by its complex structure, which includes a thiadiazole ring, amide functional groups, and various alkyl and amino substituents. This compound is typically studied for its potential biological activities, including its role as a pharmaceutical agent or in medicinal chemistry. The presence of the thiadiazole moiety often suggests potential antimicrobial or anti-inflammatory properties, while the sulfonamide group may enhance solubility and bioavailability. The steric bulk provided by the dimethyl groups can influence the compound's interaction with biological targets. Its synthesis and characterization involve standard organic chemistry techniques, including chromatography and spectroscopy, to confirm purity and structural integrity. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further research is necessary to fully elucidate its pharmacological profile and therapeutic applications.
Formula:C23H37N5O4S2
InChI:InChI=1S/C23H37N5O4S2/c1-8-24-14-15-34(31,32)25-16-23(17-12-10-9-11-13-17)28(19(30)22(5,6)7)27-20(33-23)26-18(29)21(2,3)4/h9-13,24-25H,8,14-16H2,1-7H3,(H,26,27,29)
InChI key:InChIKey=YVAFBXLHPINSIK-UHFFFAOYSA-N
SMILES:C(NS(CCNCC)(=O)=O)C1(N(C(C(C)(C)C)=O)N=C(NC(C(C)(C)C)=O)S1)C2=CC=CC=C2
Synonyms:- N-[4-(2,2-Dimethyl-1-oxopropyl)-5-[[[[2-(ethylamino)ethyl]sulfonyl]amino]methyl]-4,5-dihydro-5-phenyl-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide
- Propanamide, N-[4-(2,2-dimethyl-1-oxopropyl)-5-[[[[2-(ethylamino)ethyl]sulfonyl]amino]methyl]-4,5-dihydro-5-phenyl-1,3,4-thiadiazol-2-yl]-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Litronesib Racemate
CAS:Litronesib is a selective, allosteric inhibitor of kinesin Eg5.Litronesib (Racemate) is the racemate of litronesib.Formula:C23H37N5O4S2Color and Shape:SolidMolecular weight:511.7
