CymitQuimica logo

CAS 546122-71-8

:

bromo-[(2,4-difluorophenyl)methyl]magnesium

Description:
Bromo-[(2,4-difluorophenyl)methyl]magnesium is an organomagnesium compound, specifically a Grignard reagent, characterized by its reactivity and utility in organic synthesis. This compound features a magnesium atom bonded to a bromo group and a 2,4-difluorophenylmethyl group, which contributes to its unique properties. Grignard reagents are known for their nucleophilic behavior, allowing them to react with a variety of electrophiles, including carbonyl compounds, to form alcohols. The presence of fluorine atoms in the phenyl ring can influence the electronic properties of the molecule, potentially enhancing its reactivity. Additionally, the compound is typically sensitive to moisture and air, necessitating careful handling under an inert atmosphere. Its applications in synthetic organic chemistry include the formation of carbon-carbon bonds and the synthesis of complex molecules. As with many organometallic compounds, safety precautions are essential due to their potential reactivity and toxicity.
Formula:C7H5BrF2Mg
InChI:InChI=1/C7H5F2.BrH.Mg/c1-5-2-3-6(8)4-7(5)9;;/h2-4H,1H2;1H;/q;;+1/p-1/rC7H5BrF2Mg/c8-11-4-5-1-2-6(9)3-7(5)10/h1-3H,4H2
SMILES:C=C1C=CC(=CC1F)F.Br.[Mg]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.