CAS 54617-07-1

Benzene, 1,1′-oxybis[4-[(4-nitrophenyl)sulfonyl]-

Description:

Benzene, 1,1′-oxybis[4-[(4-nitrophenyl)sulfonyl]- (CAS 54617-07-1) is an organic compound characterized by its complex structure, which includes a benzene ring connected by an ether linkage to two sulfonamide groups. This compound features a nitrophenyl moiety, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of the nitro group typically enhances the compound's electrophilic properties, making it useful in further chemical transformations. Additionally, the sulfonyl groups can impart solubility in polar solvents and influence the compound's biological activity. The compound is likely to exhibit moderate stability under standard conditions but may undergo reactions such as nucleophilic substitution or reduction, depending on the environment. Safety data should be consulted, as compounds with nitro and sulfonyl groups can pose health risks, including toxicity and environmental hazards. Overall, this compound's unique structure and functional groups make it a subject of interest for research and industrial applications.

Formula: C₂₄H₁₆N₂O₉S₂

InChI: InChI=1S/C24H16N2O9S2/c27-25(28)17-1-9-21(10-2-17)36(31,32)23-13-5-19(6-14-23)35-20-7-15-24(16-8-20)37(33,34)22-11-3-18(4-12-22)26(29)30/h1-16H

InChI key: InChIKey=QVQFEUNHJKTHOC-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC=C(N(=O)=O)C=C1)C2=CC=C(OC3=CC=C(S(=O)(=O)C4=CC=C(N(=O)=O)C=C4)C=C3)C=C2

Synonyms:

• Bis[4-(4′-nitrophenylsulfonyl)phenyl] ether
• Benzene, 1,1′-oxybis[4-[(4-nitrophenyl)sulfonyl]-

4,4\'-Oxybis(((4-nitrophenyl)sulfonyl)benzene)

CAS: 54617-07-1

Formula: C₂₄H₁₆N₂O₉S₂

Molecular weight: 540.52

Ref: ST-EA-CP-D10045