CAS 54621-94-2
:3,4-Di-O-acetyl-L-fucal
Description:
3,4-Di-O-acetyl-L-fucal is a chemical compound that belongs to the class of fucopyranosides, which are derivatives of fucose, a naturally occurring sugar. This compound is characterized by the presence of two acetyl groups attached to the hydroxyl groups at the 3 and 4 positions of the fucal structure. It is typically a white to off-white solid and is soluble in organic solvents such as methanol and dichloromethane, but less soluble in water due to its hydrophobic nature. The acetylation enhances its stability and alters its reactivity, making it useful in various synthetic applications, particularly in carbohydrate chemistry. 3,4-Di-O-acetyl-L-fucal can serve as an intermediate in the synthesis of more complex glycosides and oligosaccharides. Its biological significance may also be explored in the context of glycoprotein synthesis and cell signaling, as fucose plays a crucial role in various biological processes. Proper handling and storage conditions are essential to maintain its integrity and prevent degradation.
Formula:C10H14O5
InChI:InChI=1/C10H14O5/c1-6-10(15-8(3)12)9(4-5-13-6)14-7(2)11/h4-6,9-10H,1-3H3/t6-,9-,10+/m0/s1
Synonyms:- 3,4-di-O-acetyl-2,6-anhydro-1,5-dideoxy-L-arabino-hex-5-enitol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4-DI-O-ACETYL-L-FUCAL,
CAS:Formula:C10H14O5Purity:95%Color and Shape:SolidMolecular weight:214.21523,4-Di-O-acetyl-L-fucal
CAS:Formula:C10H14O5Purity:(NMR) ≥ 95.0%Color and Shape:White crystalline powderMolecular weight:214.223,4-Di-O-acetyl-L-fucal
CAS:3,4-Di-O-acetyl-L-fucal is a phosphate derivative that is synthetically derived from ethyl diazoacetate. It has cytotoxic properties and is readily activated by phosphorylation to form the active form. 3,4-Di-O-acetyl-L-fucal has been shown to be effective against leukemia cells in vitro and may be useful as an adjuvant treatment for lymphocytic leukemia. 3,4-Di-O-acetyl-L-fucal also inhibits the growth of staphylococci in vitro, but it is not active against other bacteria such as Escherichia coli or Pseudomonas aeruginosa. The enantiomer of 3,4 Di O acetyl - L - fucal is inactive because it cannot be phosphorylated.Formula:C10H14O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:214.22 g/mol




