CAS 54627-94-0

5-(1H-Benzimidazol-2-yl)-2(1H)-pyridinone

Description:

5-(1H-Benzimidazol-2-yl)-2(1H)-pyridinone, with the CAS number 54627-94-0, is a chemical compound that features a fused bicyclic structure comprising a benzimidazole and a pyridinone moiety. This compound is characterized by its potential biological activity, often studied for its role in medicinal chemistry, particularly as a scaffold for drug development. It typically exhibits properties such as moderate solubility in organic solvents and may show varying degrees of solubility in water, depending on the specific conditions. The presence of nitrogen atoms in its structure contributes to its ability to form hydrogen bonds, which can influence its interaction with biological targets. Additionally, the compound may exhibit fluorescence properties, making it useful in various analytical applications. Its structural features suggest potential applications in areas such as anti-cancer research, antimicrobial activity, and enzyme inhibition. As with many heterocyclic compounds, the specific reactivity and stability can vary based on environmental conditions and substituents present on the molecule.

Formula: C₁₂H₉N₃O

InChI: InChI=1S/C12H9N3O/c16-11-6-5-8(7-13-11)12-14-9-3-1-2-4-10(9)15-12/h1-7H,(H,13,16)(H,14,15)

InChI key: InChIKey=SVRLGIZVNZPDAS-UHFFFAOYSA-N

SMILES: O=C1C=CC(C=2NC=3C(N2)=CC=CC3)=CN1

Synonyms:

• 5-(1H-Benzimidazol-2-yl)-2(1H)-pyridinone
• 2(1H)-Pyridinone, 5-(1H-benzimidazol-2-yl)-

5-(1H-BENZOIMIDAZOL-2-YL)-PYRIDIN-2-OL

CAS: 54627-94-0

Formula: C₁₂H₉N₃O

Purity: 95%

Molecular weight: 211.2194

Ref: IN-DA00DBC6

5-(1H-benzo[d]imidazol-2-yl)pyridin-2-ol

CAS: 54627-94-0

5-(1H-benzo[d]imidazol-2-yl)pyridin-2-ol

Purity: 95%

Molecular weight: 211.22g/mol

Ref: 54-OR86531

5-(1H-Benzimidazol-2-yl)pyridin-2-ol

CAS: 54627-94-0

5-(1H-Benzimidazol-2-yl)pyridin-2-ol is a proapoptotic agent that is synthesized from the reaction of benzimidazole with 2-chloroacetic acid. This compound was found to be cytotoxic and proapoptotic in ovarian cancer cells, as it inhibits DNA polymerase activity and induces apoptosis. 5-(1H-Benzimidazol-2-yl)pyridin-2-ol has been shown to activate caspase 3, which may lead to the activation of downstream events such as mitochondrial membrane permeabilization, cytochrome c release, and caspase 9 activation. The mechanism of action for this drug is still under investigation.

Formula: C₁₂H₉N₃O

Purity: Min. 95%

Molecular weight: 211.21 g/mol

Ref: 3D-ECA62794