CAS 5463-22-9

1,2-bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione

Description:

1,2-bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione, commonly known as a derivative of flavonoids, is a chemical compound characterized by its complex structure featuring two phenolic groups attached to a central ethane-1,2-dione moiety. This compound exhibits notable antioxidant properties, which are attributed to the presence of hydroxyl groups that can donate hydrogen atoms to free radicals, thereby stabilizing them. It is typically soluble in organic solvents and may exhibit limited solubility in water due to its hydrophobic aromatic rings. The compound's structure allows for potential applications in pharmaceuticals and cosmetics, particularly in formulations aimed at skin protection and anti-aging due to its ability to scavenge reactive oxygen species. Additionally, its phenolic nature contributes to its potential as a natural preservative in food products. As with many organic compounds, it is essential to handle it with care, considering safety data and potential toxicity, especially in concentrated forms.

Formula: C₁₆H₁₄O₆

InChI: InChI=1/C16H14O6/c1-21-13-7-9(3-5-11(13)17)15(19)16(20)10-4-6-12(18)14(8-10)22-2/h3-8,17-18H,1-2H3

bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione

CAS: 5463-22-9

Formula: C₁₆H₁₄O₆

Purity: 95%

Color and Shape: Solid

Molecular weight: 302.2788

Ref: IN-DA0037A7

1,2-Bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione

CAS: 5463-22-9

Purity: 95%

Molecular weight: 302.2820129

Ref: 10-F754541