CAS 5463-29-6
:6-bromo-2-hydroxyquinoline-4-carboxylic acid
Description:
6-Bromo-2-hydroxyquinoline-4-carboxylic acid is an organic compound characterized by its quinoline structure, which features a bromine atom, a hydroxyl group, and a carboxylic acid functional group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the hydroxyl and carboxylic acid groups, which can engage in hydrogen bonding. The bromine substituent enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The compound may exhibit various properties such as antimicrobial or anti-inflammatory activities, which are common in derivatives of quinoline. Its molecular structure allows for potential applications in pharmaceuticals, agrochemicals, and as a reagent in organic synthesis. Additionally, the presence of multiple functional groups suggests that it can participate in various chemical reactions, including esterification and nucleophilic substitutions. Overall, 6-bromo-2-hydroxyquinoline-4-carboxylic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C10H6BrNO3
InChI:InChI=1/C10H6BrNO3/c11-5-1-2-8-6(3-5)7(10(14)15)4-9(13)12-8/h1-4H,(H,12,13)(H,14,15)
SMILES:c1cc2c(cc1Br)c(cc(n2)O)C(=O)O
Synonyms:- 6-Bromo-2-Oxo-1,2-Dihydroquinoline-4-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-bromo-2-hydroxyquinoline-4-carboxylic acid
CAS:Formula:C10H6BrNO3Purity:98%Color and Shape:SolidMolecular weight:268.06356-Bromo-2-hydroxyquinoline-4-carboxylic acid 95+%
CAS:6-Bromo-2-hydroxyquinoline-4-carboxylic acid 95+%Purity:95%6-Bromo-2-oxo-1,2-dihydroquinoline-4-carboxylic acid
CAS:6-Bromo-2-oxo-1,2-dihydroquinoline-4-carboxylic acidPurity:98%Color and Shape:SolidMolecular weight:268.06g/mol6-Bromo-2-oxo-1,2-dihydroquinoline-4-carboxylic acid
CAS:Formula:C10H6BrNO3Purity:98%Molecular weight:268.0666-Bromo-2-oxo-1,2-dihydroquinoline-4-carboxylic acid
CAS:6-Bromo-2-oxo-1,2-dihydroquinoline-4-carboxylic acid is a corrosion inhibitor with potentiodynamic polarization. It is a potent inhibitor of chloride ion transport in electrochemical systems. 6-Bromo-2-oxo-1,2-dihydroquinoline-4-carboxylic acid has been shown to inhibit the corrosion of steel in hydrochloric acid solutions and to have an efficiency that is greater than that of other known inhibitors. The inhibition efficiency of 6BQCA can be modeled using impedance spectroscopy, which is a functional theory for the study of diffusion of current through electrolytic solutions.Formula:C10H6BrNO3Purity:Min. 95%Molecular weight:268.06 g/mol



