CAS 5463-50-3
:4,7-dimethyl-2-benzofuran-1,3-dione
Description:
4,7-Dimethyl-2-benzofuran-1,3-dione, also known as a derivative of benzofuran, is an organic compound characterized by its fused benzene and furan rings, along with two methyl groups at the 4 and 7 positions. This compound features a diketone functional group, which contributes to its reactivity and potential applications in organic synthesis. It typically appears as a solid at room temperature and is soluble in organic solvents. The presence of the diketone moiety allows for various chemical transformations, making it useful in the synthesis of more complex molecules. Its structure suggests potential biological activity, and it may be investigated for applications in pharmaceuticals or agrochemicals. The compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C10H8O3
InChI:InChI=1/C10H8O3/c1-5-3-4-6(2)8-7(5)9(11)13-10(8)12/h3-4H,1-2H3
SMILES:Cc1ccc(C)c2c1C(=O)OC2=O
Synonyms:- 4,7-Dimethyl-1,3-isobenzofurandione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,3-Isobenzofurandione,4,7-dimethyl-
CAS:Formula:C10H8O3Purity:97%Color and Shape:SolidMolecular weight:176.16873,6-Dimethylphthalic anhydride
CAS:<p>3,6-Dimethylphthalic anhydride</p>Purity:97%Color and Shape:SolidMolecular weight:176.17g/mol4,7-dimethyl-1,3-dihydro-2-benzofuran-1,3-dione
CAS:Controlled Product<p>Stability Moisture Sensitive<br>Applications 4,7-dimethyl-1,3-dihydro-2-benzofuran-1,3-dione (cas# 5463-50-3) is a useful research chemical.<br></p>Formula:C10H8O3Color and Shape:NeatMolecular weight:176.174,7-Dimethyl-1,3-dihydro-2-benzofuran-1,3-dione
CAS:<p>4,7-Dimethyl-1,3-dihydro-2-benzofuran-1,3-dione is a functional theory that stabilizes the molecule by preventing the formation of an intermediate. It can be used to prevent the generation of reactive radicals and other undesirable side reactions. 4,7-Dimethyl-1,3-dihydro-2-benzofuran-1,3-dione is uncatalyzed and reacts with water to form a cyclic compound that has a section of two functional groups that are bifunctional in nature. The parameters for this reaction include acid as a catalyst and proton as an acceptor. In catalysis, hydrogen bond forms between hydrogen fluoride and one of the hydroxyl groups on the 4,7 dimethyl benzofuran ring. This bond breaks down during dehydration when hydrogen fluoride leaves the molecule to form water.</p>Formula:C10H8O3Purity:Min. 95%Molecular weight:176.17 g/mol





