CAS 5463-64-9
:2,2′-(1,2-Ethenediyl)bis[5-[2-(4-amino-1-naphthalenyl)diazenyl]benzenesulfonic acid]
Description:
The chemical substance known as 2,2′-(1,2-Ethenediyl)bis[5-[2-(4-amino-1-naphthalenyl)diazenyl]benzenesulfonic acid], with the CAS number 5463-64-9, is a synthetic organic compound characterized by its complex structure, which includes azo and sulfonic acid functional groups. This compound features a central ethenediyl linkage connecting two aromatic systems, each containing a diazenyl group and a sulfonic acid moiety. The presence of the sulfonic acid groups contributes to its water solubility and potential applications in dye chemistry, particularly in the development of azo dyes. The amino group on the naphthalene ring enhances its reactivity and may facilitate further chemical modifications. Additionally, the compound's azo linkage imparts vivid coloration, making it useful in various applications, including textiles and biological staining. Its structural characteristics suggest potential utility in fields such as materials science and biochemistry, where its unique properties can be harnessed for specific applications.
Formula:C34H26N6O6S2
InChI:InChI=1S/C34H26N6O6S2/c35-29-15-17-31(27-7-3-1-5-25(27)29)39-37-23-13-11-21(33(19-23)47(41,42)43)9-10-22-12-14-24(20-34(22)48(44,45)46)38-40-32-18-16-30(36)26-6-2-4-8-28(26)32/h1-20H,35-36H2,(H,41,42,43)(H,44,45,46)
InChI key:InChIKey=BEOHKTZPLVXCFG-UHFFFAOYSA-N
SMILES:N(=NC1=CC(S(=O)(=O)O)=C(C=CC2=C(S(=O)(=O)O)C=C(N=NC=3C4=C(C(N)=CC3)C=CC=C4)C=C2)C=C1)C=5C6=C(C(N)=CC5)C=CC=C6
Synonyms:- 2,2'-(E)-ethene-1,2-diylbis{5-[(E)-(4-aminonaphthalen-1-yl)diazenyl]benzenesulfonic acid}
- 2,2'-Stilbenedisulfonic acid, 4,4'-bis((4-amino-1-naphthyl)azo)-
- 2,2'-ethene-1,2-diylbis{5-[(E)-(4-aminonaphthalen-1-yl)diazenyl]benzenesulfonic acid}
- 2,2′-(1,2-Ethenediyl)bis[5-[2-(4-amino-1-naphthalenyl)diazenyl]benzenesulfonic acid]
- 4,4′-Bis(2-amino-1-naphthylazo)-2,2′-stilbenedisulfonic acid
- 4,4′-Bis(4-amino-1-naphthylazo)-2,2′-stilbenedisulfonic acid
- Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis(5-((4-amino-1-naphthalenyl)azo)-
- Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis(5-(2-(4-amino-1-naphthalenyl)diazenyl)-
- Nsc 5067
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,2′-(1,2-Ethenediyl)bis[5-[2-(4-amino-1-naphthalenyl)diazenyl]benzenesulfonic acid]
CAS:Formula:C34H26N6O6S2Color and Shape:SolidMolecular weight:678.73684,4'-Bis(4-amino-1-naphthylazo)-2,2'-stilbenedisulfonic Acid (Technical Grade)
CAS:Controlled ProductApplications A new indicator for the determination of organic acid anhydrides by the morpholine method.
References Ruch, J.E., et al.: Anal. Chem., 47, 2057 (1975),Formula:C34H26N6O6S2Color and Shape:NeatMolecular weight:678.744,4'-Bis(4-amino-1-naphthylazo)-2,2'-stilbenedisulfonic acid - 70%
CAS:4,4'-Bis(4-amino-1-naphthylazo)-2,2'-stilbenedisulfonic acid - 70% (DABS) is a chemical compound that has been used in biochemical research. It is an azo dye and was originally synthesized by reacting 1-naphthol with 4-aminodiphenylamine. The color of DABS varies according to the pH. It can be obtained as either a red or blue compound at pH > 7 and as a yellow compound at pH 7. DABS interacts with human recombinant proteins, such as collagen and endoplasmic reticulum, and is capable of binding to the surface of cells. This dye also shows biological properties that are similar to those of phenothiazines when it is used in biochemical experiments involving recombinant human proteins.Formula:C34H26N6O6S2Purity:Min. 95%Color and Shape:Purple PowderMolecular weight:678.74 g/mol


