CymitQuimica logo

CAS 54634-49-0

:

1-Nitroso-2-pyrrolidinone

Description:
1-Nitroso-2-pyrrolidinone is an organic compound characterized by its nitroso functional group attached to a pyrrolidinone ring. This compound typically appears as a yellow to orange solid and is known for its potential applications in organic synthesis and as an intermediate in various chemical reactions. The presence of the nitroso group imparts unique reactivity, making it useful in the formation of other nitrogen-containing compounds. It is soluble in polar solvents, which facilitates its use in various chemical processes. However, like many nitroso compounds, it may pose health risks, including potential mutagenicity, necessitating careful handling and storage. The compound's stability can be influenced by environmental factors such as light and temperature, which may lead to decomposition or changes in its chemical properties. Overall, 1-Nitroso-2-pyrrolidinone is a significant compound in the field of synthetic organic chemistry, with ongoing research into its properties and applications.
Formula:C4H6N2O2
InChI:InChI=1S/C4H6N2O2/c7-4-2-1-3-6(4)5-8/h1-3H2
InChI key:InChIKey=KLZYCEYOOVIITI-UHFFFAOYSA-N
SMILES:N(=O)N1C(=O)CCC1
Synonyms:
  • 1-Nitroso-2-pyrrolidinone
  • 1-Nitroso-2-pyrrolidone
  • 2-Pyrrolidinone, 1-Nitroso-
  • N-Nitroso-2-pyrrolidinone
  • 1-Nitrosopyrrolidin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.