CAS 5464-22-2: 1,1,2,2-Ethanetetracarboxylic acid, 1,1,2,2-tetramethyl ester
Description:1,1,2,2-Ethanetetracarboxylic acid, 1,1,2,2-tetramethyl ester, commonly referred to as a derivative of ethanetetracarboxylic acid, is an organic compound characterized by its four carboxylic acid groups, each of which is esterified with methyl groups. This structure contributes to its relatively high molecular weight and unique chemical properties. The compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic methyl groups. The presence of multiple carboxylate groups allows for potential applications in various fields, including as a building block in organic synthesis, in polymer chemistry, and as a potential ligand in coordination chemistry. Additionally, its reactivity can be influenced by the steric hindrance introduced by the tetramethyl groups, which may affect its interactions with other chemical species. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C10H14O8
InChI:InChI=1S/C10H14O8/c1-15-7(11)5(8(12)16-2)6(9(13)17-3)10(14)18-4/h5-6H,1-4H3
InChI key:InChIKey=YFBFTGJJUOXWIC-UHFFFAOYSA-N
SMILES:O=C(OC)C(C(=O)OC)C(C(=O)OC)C(=O)OC
- Synonyms:
- Tetramethyl 1,1,2,2-ethanetetracarboxylate
- 1,1,2,2-Ethanetetracarboxylic acid, 1,1,2,2-tetramethyl ester
- NSC 15766
- 1,1,2,2-Ethanetetracarboxylic acid, tetramethyl ester
- sym-Tetracarbomethoxyethane
- Tetramethyl ethane-1,1,2,2-tetracarboxylate
1,1,2,2-Ethanetetracarboxylic acid, tetramethyl ester
Ref: IN-DA0038NR
| 1g | 67.00 € | ||
| 5g | 179.00 € | ||
| 10g | 245.00 € |
Ethane-1,1,2,2-tetracarboxylic acid tetramethylester
Ref: 10-F034925
| 1g | 57.00 € | ||
| 5g | 190.00 € |
Ethane-1,1,2,2-tetracarboxylic acid tetramethylester
Ref: 3D-FAA46422
| 25g | 1,482.00 € | ||
| 2500mg | 410.00 € |
