CAS 5464-22-2
:1,1,2,2-Ethanetetracarboxylic acid, 1,1,2,2-tetramethyl ester
Description:
1,1,2,2-Ethanetetracarboxylic acid, 1,1,2,2-tetramethyl ester, commonly referred to as a derivative of ethanetetracarboxylic acid, is an organic compound characterized by its four carboxylic acid groups, each of which is esterified with methyl groups. This structure contributes to its relatively high molecular weight and unique chemical properties. The compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic methyl groups. The presence of multiple carboxylate groups allows for potential applications in various fields, including as a building block in organic synthesis, in polymer chemistry, and as a potential ligand in coordination chemistry. Additionally, its reactivity can be influenced by the steric hindrance introduced by the tetramethyl groups, which may affect its interactions with other chemical species. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C10H14O8
InChI:InChI=1/C10H14O8/c1-15-7(11)5(8(12)16-2)6(9(13)17-3)10(14)18-4/h5-6H,1-4H3
InChI key:InChIKey=YFBFTGJJUOXWIC-UHFFFAOYSA-N
SMILES:C(C(C(OC)=O)C(OC)=O)(C(OC)=O)C(OC)=O
Synonyms:- Tetramethyl 1,1,2,2-ethanetetracarboxylate
- 1,1,2,2-Ethanetetracarboxylic acid, 1,1,2,2-tetramethyl ester
- NSC 15766
- 1,1,2,2-Ethanetetracarboxylic acid, tetramethyl ester
- sym-Tetracarbomethoxyethane
- Tetramethyl ethane-1,1,2,2-tetracarboxylate
- Ethane-1,1,2,2-tetracarboxylic acid tetramethyl
- 1,1,2,2-Tetramethyl ethane-1,1,2,2-tetracarboxylate
- Ethane-1,1,2,2-tetracarboxylic aci
- (2S)-4-(methylthio)-2-[[[[(2S)-4-(methylthio)-1-(4-nitrophenoxy)-1-oxobutan-2-yl]amino]-oxomethyl]amino]butanoic acid (4-nitrophenyl) ester
- etramethylethane-1,1,2,2-tetracarboxylate
- 2,2,3,3-Butanetetracarboxylic acid, 1,2,3,4-tetraMethyl ester
- AKOS 92220
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,1,2,2-Ethanetetracarboxylic acid, tetramethyl ester
CAS:Formula:C10H14O8Purity:95%Color and Shape:SolidMolecular weight:262.21341,1,2,2-Tetramethyl ethane-1,1,2,2-tetracarboxylate
CAS:<p>1,1,2,2-Tetramethyl ethane-1,1,2,2-tetracarboxylate</p>Molecular weight:262.21336g/molEthane-1,1,2,2-tetracarboxylic acid tetramethylester
CAS:Formula:C10H14O8Purity:95%Color and Shape:SolidMolecular weight:262.214Ethane-1,1,2,2-tetracarboxylic acid tetramethylester
CAS:<p>Ethane-1,1,2,2-tetracarboxylic acid tetramethylester (ETM) is a triamide that can be used as a stabilizing agent in organic synthesis. It is believed to increase the yields of reactions by acting as an estimator for the population of carbenes that are generated during chemical reactions. ETM has been shown to be an isomerizer and can stabilize molecules with electron-deficient carbonyls. ETM has also been shown to exist in both solid and liquid phases and its mechanism of stabilization is hypothesized to involve coordination between the ETM molecule and the substrate molecule. The coexistence of two different phases may be due to the ability of ETM to catalyze electrolysis reactions.</p>Formula:C10H14O8Purity:Min. 95%Molecular weight:262.21 g/mol




