CAS 5464-98-2
:4-Hydroxy-3-nitrobenzophenone
Description:
4-Hydroxy-3-nitrobenzophenone, with the CAS number 5464-98-2, is an organic compound that belongs to the class of benzophenones, which are characterized by the presence of two phenyl rings connected by a carbonyl group. This particular compound features a hydroxyl group (-OH) and a nitro group (-NO2) attached to the benzophenone structure, which contributes to its chemical reactivity and potential applications. It typically appears as a solid and is known for its ability to absorb ultraviolet (UV) light, making it useful in various applications such as UV filters in sunscreens and plastics. The presence of the nitro group can also influence its electronic properties, potentially enhancing its reactivity in certain chemical reactions. Additionally, 4-Hydroxy-3-nitrobenzophenone may exhibit biological activity, which could be of interest in pharmaceutical research. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C13H9NO4
InChI:InChI=1/C13H9NO4/c15-12-7-6-10(8-11(12)14(17)18)13(16)9-4-2-1-3-5-9/h1-8,15H
SMILES:c1ccc(cc1)C(=O)c1ccc(c(c1)N(=O)=O)O
Synonyms:- (4-Hydroxy-3-Nitrophenyl)(Phenyl)Methanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Hydroxy-3-nitrobenzophenone
CAS:<p>4-Hydroxy-3-nitrobenzophenone is a divinylbenzen compound that is used as a polymerization catalyst. This product is an efficient method for synthesizing polymeric matrices containing immobilized carboxylic acids, which can be used in chromatographic science. 4-Hydroxy-3-nitrobenzophenone has been shown to have anticholinesterase activity and can be used for the synthesis of polymeric matrices containing immobilized carboxylic acids, which can be used in chromatographic science. 4-Hydoxy-3-nitrobenzophenone also has an acid catalyst that can react with glyceraldehyde 3 phosphate dehydrogenase.</p>Formula:C13H9NO4Purity:Min. 95%Color and Shape:SolidMolecular weight:243.21 g/mol
