CAS 5465-18-9

4-(3,4-dimethylphenyl)butanoic acid

Description:

4-(3,4-Dimethylphenyl)butanoic acid, with the CAS number 5465-18-9, is an organic compound characterized by its butanoic acid backbone substituted with a 3,4-dimethylphenyl group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water is limited due to its hydrophobic aromatic structure. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The compound's melting point, boiling point, and specific reactivity can vary based on purity and environmental conditions. Additionally, safety data should be consulted to understand its handling and potential hazards, as with any chemical substance. Overall, 4-(3,4-dimethylphenyl)butanoic acid exemplifies the diverse functionalities of organic compounds in chemical research and industry.

Formula: C₁₂H₁₆O₂

InChI: InChI=1/C12H16O2/c1-9-6-7-11(8-10(9)2)4-3-5-12(13)14/h6-8H,3-5H2,1-2H3,(H,13,14)

SMILES: Cc1ccc(CCCC(=O)O)cc1C

4-(3,4-Dimethylphenyl)butanoic acid

CAS: 5465-18-9

Versatile small molecule scaffold

Formula: C₁₂H₁₆O₂

Purity: Min. 95%

Molecular weight: 192.25 g/mol

Ref: 3D-FAA46518