CAS 5465-34-9

2-amino-5-methyl-3-nitrobenzoic acid

Description:

2-Amino-5-methyl-3-nitrobenzoic acid, with the CAS number 5465-34-9, is an aromatic amino acid derivative characterized by the presence of an amino group (-NH2), a methyl group (-CH3), and a nitro group (-NO2) attached to a benzoic acid structure. This compound typically appears as a crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its carboxylic acid functional group. The presence of the nitro group introduces significant electron-withdrawing properties, which can influence the compound's reactivity and acidity. It is often used in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. The compound's structure allows for various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in synthetic organic chemistry. Additionally, its biological activity may be explored in various contexts, including potential applications in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₈H₈N₂O₄

InChI: InChI=1/C8H8N2O4/c1-4-2-5(8(11)12)7(9)6(3-4)10(13)14/h2-3H,9H2,1H3,(H,11,12)

SMILES: Cc1cc(c(c(c1)N(=O)=O)N)C(=O)O

Synonyms:

• Benzoic Acid, 2-Amino-5-Methyl-3-Nitro-
• 2-Amino-5-Methyl-3-Nitro-Benzoic Acid

NSC28975

CAS: 5465-34-9

Formula: C₈H₈N₂O₄

Purity: %

Molecular weight: 196.1601

Ref: IN-DA00DBE5

2-Amino-5-methyl-3-nitrobenzoic acid

CAS: 5465-34-9

2-Amino-5-methyl-3-nitrobenzoic acid

Purity: 95%

Molecular weight: 196.16g/mol

Ref: 54-OR1064629

2-Amino-5-methyl-3-nitrobenzoic acid

CAS: 5465-34-9

2-Amino-5-methyl-3-nitrobenzoic acid is a heterocyclic compound that has been shown to rearrange under acidic conditions. It can be synthesized by the reaction of 2-amino-5-methylbenzoic acid and sodium nitrite in the presence of benzotriazole. This compound is used as a reagent for spectroscopy, such as NMR and IR. The IR spectrum of this compound shows absorption bands at 3351, 1707, 1671, 1533, 1492, 1377, 1283, 1166 cm−1.

Formula: C₈H₈N₂O₄

Purity: Min. 95%

Molecular weight: 196.16 g/mol

Ref: 3D-FAA46534